myclobutanil

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| ImageFile = Myclobutanil Grundstruktur V1.svg

| ImageSize = 200px

| ImageFile_Ref = {{chemboximage|correct|??}}

| ImageName = Kekulé, skeletal formula of myclobutanil

| ImageFile2 = Myclobutanil.png

| ImageSize2 = 200px

| ImageName2 = Kekulé, skeletal formula of myclobutanil

| IUPACName = 2-(4-Chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 88671-89-0

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 6336

| PubChem1 = 11077077

| PubChem1_Comment = (2R)

| PubChem2 = 38989055

| PubChem2_Comment = (2S)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = B6T1JTM6KZ

| ChemSpiderID = 6096

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID1 = 9252226

| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID1_Comment = (2R)

| EINECS = 410-400-0

| UNNumber = 3077

| KEGG = C18477

| KEGG_Ref = {{keggcite|correct|kegg}}

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 75281

| MeSHName = Systhane

| RTECS = XZ5257000

| Beilstein = 7138849

| SMILES = CCCCC(Cn1cncn1)(C#N)c1ccc(Cl)cc1

| StdInChI = 1S/C15H17ClN4/c1-2-3-8-15(9-17,10-20-12-18-11-19-20)13-4-6-14(16)7-5-13/h4-7,11-12H,2-3,8,10H2,1H3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = HZJKXKUJVSEEFU-UHFFFAOYSA-N

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

}}

|Section2={{Chembox Properties

| C=15 | H=17 | N=4 | Cl=1

| Appearance = Pale, yellow, translucent crystals

| MeltingPtC = 63 to 68

| BoilingPtC = 202 to 208

| BoilingPt_notes = at 130 Pa

| Solubility = 142{{nbsp}}mg⋅dm−3

}}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS exclamation mark}} {{GHS health hazard}} {{GHS environment}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|302|319|361|411}}

| PPhrases = {{P-phrases|273|281|305+351+338}}

| NFPA-H = 2

| NFPA-F = 1

| NFPA-R = 0

| FlashPt = >

| FlashPtC = 100

}}

| verifiedrevid = 462256248

}}

Myclobutanil is a triazole chemical used as a fungicide. It is a steroid demethylation (CYP51) inhibitor, specifically inhibiting ergosterol biosynthesis. Ergosterol is a critical component of fungal cell membranes.

Stereoisomerism

class="wikitable" style="text-align:center;"
class="hintergrundfarbe6"

! colspan="2" | Myclobutanil (2 stereoisomers)

File:(S)-Myclobutanil V1.svg
{{small|(S)-configuration}}

| File:(R)-Myclobutanil V1.svg
{{small|(R)-configuration}}

== Safety ==

The Safety Data Sheet indicates the following hazards:

  • Suspected of damaging fertility or the unborn child.
  • Toxic to aquatic life with long lasting effects.{{cite web |title=SAFETY DATA SHEET Myclobutanil |url=https://www.caymanchem.com/msdss/24100m.pdf |publisher=Cayman Chemical Company |access-date=11 August 2021}}

The first hazard has caused this chemical to be placed on the 1986 California Proposition 65 toxics list.

When heated, myclobutanil decomposes to produce corrosive and/or toxic fumes, including carbon monoxide, carbon dioxide, hydrogen chloride, hydrogen cyanide, and nitrogen oxides.{{cite web|url=https://cameochemicals.noaa.gov/chemical/30020|title=MYCLOBUTANIL - CAMEO Chemicals - NOAA|first=NOAA Office of Response and Restoration, US|last=GOV|website=cameochemicals.noaa.gov}}{{cite web | url = http://www.dow.com/webapps/include/GetDoc.aspx?filepath=productsafety/pdfs/noreg/233-01023.pdf&pdf=true | title = Product Safety Assessment: Myclobutanil}}

== Banned for cannabis cultivation==

Myclobutanil is banned in Canada, Colorado, Washington, Oregon, and Oklahoma for the production of medical and recreational cannabis. In 2014, a Canadian news investigation by The Globe and Mail reported the discovery of myclobutanil in medical cannabis produced by at least one government licensed grower.{{cite news|url=https://www.theglobeandmail.com/news/national/canadians-not-told-about-banned-pesticide-found-in-medical-marijuana-supply/article33443887/|title=Canadians not told about banned pesticide found in medical pot supply|via=The Globe and Mail}} In September 2019, NBC News commissioned CannaSafe to test THC cartridges for heavy metals, pesticides, and residual solvents like Vitamin E; pesticides, including myclobutanil, was found in products from unlicensed dealers.{{cite web |url=https://www.nbcnews.com/health/vaping/tests-show-bootleg-marijuana-vapes-tainted-hydrogen-cyanide-n1059356 |title=Tests show bootleg marijuana vapes tainted with hydrogen cyanide|website=NBC News}} In Michigan, the current state action limit for myclobutanil is 200 ppb in cannabis products.{{cite web|url=https://www.michigan.gov/documents/lara/Department_Banned_Pesticide_Active_Ingredient_List_620039_7.pdf&pdf=true | title = Technical Bulletin}}

References

{{Reflist}}