neamine

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| IUPAC_name = (1R,2R,3S,4R,6S)-4,6-Diamino-2,3-dihydroxycyclohexyl 2,6-diamino-2,6-dideoxy-α-D-glucopyranoside

| synonyms = Neomycin A

| image = Neamine.svg

| CAS_number = 3947-65-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5981U00LY0

| ATC_prefix =

| ATC_suffix =

| PubChem = 72392

| DrugBank = DB04808

| ChemSpiderID = 65325

| C=12 | H=26 | N=4 | O=6

| smiles = O([C@H]1[C@H](O)[C@@H](O)[C@H](N)C[C@@H]1N)[C@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2N)CN

| StdInChI = 1S/C12H26N4O6/c13-2-5-8(18)9(19)6(16)12(21-5)22-11-4(15)1-3(14)7(17)10(11)20/h3-12,17-20H,1-2,13-16H2/t3-,4+,5-,6-,7+,8-,9-,10-,11-,12-/m1/s1

| StdInChIKey = SYJXFKPQNSDJLI-HKEUSBCWSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

}}

Neamine (neomycin A) is a degradation product of the aminoglycoside antibiotic neomycin.{{cite journal | title = Neamine, an Antibacterial Degradation Product of Neomycin | date = June 1951 | vauthors = Leach BE, Teeters CM | journal = Journal of the American Chemical Society | volume = 73 | issue = 6 | pages = 2794–2797 | doi = 10.1021/ja01150a107 }} Several derivatives of neamine are active against susceptible and resistant Gram-positive and Gram-negative bacteria.{{cite journal | vauthors = Zimmermann L, Bussière A, Ouberai M, Baussanne I, Jolivalt C, Mingeot-Leclercq MP, Décout JL | title = Tuning the antibacterial activity of amphiphilic neamine derivatives and comparison to paromamine homologues | journal = Journal of Medicinal Chemistry | volume = 56 | issue = 19 | pages = 7691–7705 | date = October 2013 | pmid = 24083676 | doi = 10.1021/jm401148j }}