necopidem
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 447997301
| IUPAC_name = N-([2-(4-ethylphenyl)-6-methylimidazo[1,2-a]pyridin-3-yl]methyl)-N,3-dimethylbutanamide
| image = Necopidem.svg
| width = 222
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 103844-77-5
| ATC_prefix = none
| ATC_suffix =
| PubChem = 3047786
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2310104
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = G4N2F166MN
| ChEMBL = 2105143
| C=23 | H=29 | N=3 | O=1
| smiles = O=C(N(C)Cc1c(nc2ccc(cn12)C)c3ccc(cc3)CC)CC(C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C23H29N3O/c1-6-18-8-10-19(11-9-18)23-20(15-25(5)22(27)13-16(2)3)26-14-17(4)7-12-21(26)24-23/h7-12,14,16H,6,13,15H2,1-5H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YRMLUAGKHYADKJ-UHFFFAOYSA-N
}}
Necopidem is a drug in the imidazopyridine family, which is related to the better known drugs zolpidem and alpidem. It is therefore considered a nonbenzodiazepine and as such may have sedative and anxiolytic effects, given its structural similarity to other nonbenzodiazepine hypnotics.{{cite journal | vauthors = Duan GY, Zhang YJ, Hao BQ | title = Ethyl 8-(4-nitro-phen-yl)imidazo[1,2-a]pyridine-7-carboxyl-ate | journal = Acta Crystallographica Section E | volume = 66 | issue = Pt 12 | pages = o3272 | date = November 2010 | pmid = 21589555 | pmc = 3011613 | doi = 10.1107/S1600536810047938 }}
References
{{reflist}}
{{Hypnotics and sedatives}}
{{GABAAR PAMs}}
Category:GABAA receptor positive allosteric modulators
{{sedative-stub}}