necopidem

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 447997301

| IUPAC_name = N-([2-(4-ethylphenyl)-6-methylimidazo[1,2-a]pyridin-3-yl]methyl)-N,3-dimethylbutanamide

| image = Necopidem.svg

| width = 222

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 103844-77-5

| ATC_prefix = none

| ATC_suffix =

| PubChem = 3047786

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2310104

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = G4N2F166MN

| ChEMBL = 2105143

| C=23 | H=29 | N=3 | O=1

| smiles = O=C(N(C)Cc1c(nc2ccc(cn12)C)c3ccc(cc3)CC)CC(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H29N3O/c1-6-18-8-10-19(11-9-18)23-20(15-25(5)22(27)13-16(2)3)26-14-17(4)7-12-21(26)24-23/h7-12,14,16H,6,13,15H2,1-5H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = YRMLUAGKHYADKJ-UHFFFAOYSA-N

}}

Necopidem is a drug in the imidazopyridine family, which is related to the better known drugs zolpidem and alpidem. It is therefore considered a nonbenzodiazepine and as such may have sedative and anxiolytic effects, given its structural similarity to other nonbenzodiazepine hypnotics.{{cite journal | vauthors = Duan GY, Zhang YJ, Hao BQ | title = Ethyl 8-(4-nitro-phen-yl)imidazo[1,2-a]pyridine-7-carboxyl-ate | journal = Acta Crystallographica Section E | volume = 66 | issue = Pt 12 | pages = o3272 | date = November 2010 | pmid = 21589555 | pmc = 3011613 | doi = 10.1107/S1600536810047938 }}