nerisopam

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 450847795

| IUPAC_name = 4-(7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepin-1-yl)aniline

| image = Nerisopam structure.svg

| width = 190

| tradename =

| legal_status =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 102771-12-0

| ATC_prefix = none

| PubChem = 65875

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2104732

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 59284

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 18Q4O339AG

| C=18 | H=19 | N=3 | O=2

| smiles = O(c1c(OC)cc/2c(c1)C/C(=N\N=C\2c3ccc(N)cc3)C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H19N3O2/c1-11-8-13-9-16(22-2)17(23-3)10-15(13)18(21-20-11)12-4-6-14(19)7-5-12/h4-7,9-10H,8,19H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WWQDEXGFYVSTCX-UHFFFAOYSA-N

}}

Nerisopam (GYKI-52322, EGIS-6775) is a drug which is a 2,3-benzodiazepine derivative, related to tofisopam. It has potent anxiolytic and neuroleptic effects in animal studies.{{cite journal | vauthors = Horváth K, Andrási F, Berzsenyi P, Pátfalusi M, Patthy M, Szabó G, Sebestyén L, Bagdy E, Körösi J, Botka P | title = A new psychoactive 5H-2,3-benzodiazepine with a unique spectrum of activity | journal = Arzneimittel-Forschung | volume = 39 | issue = 8 | pages = 894–9 | date = August 1989 | pmid = 2573361 }}{{cite journal | vauthors = Horváth K, Andrási F, Botka P, Hámori T | title = Anxiolytic profile of girisopam and GYKI 52,322 (EGIS 6775). Comparison with chlordiazepoxide and buspirone | journal = Acta Physiologica Hungarica | volume = 79 | issue = 2 | pages = 153–61 | date = 1992 | pmid = 1363928 }}{{cite journal | vauthors = Palkovits M, Baffi JS, Berzsenyi P, Horváth EJ | title = Anxiolytic homophthalazines increase Fos-like immunoreactivity in selected brain areas of the rat | journal = European Journal of Pharmacology | volume = 331 | issue = 1 | pages = 53–63 | date = July 1997 | pmid = 9274930 | doi = 10.1016/s0014-2999(97)01008-x }}