neticonazole

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 449870016

| IUPAC_name = 1-{(E)-2-(Methylthio)-1-[2-(pentyloxy)phenyl]vinyl}-1H-imidazole

| image = Neticonazole.svg

| tradename =

| Drugs.com = {{drugs.com|international|neticonazole}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 130726-68-0

| ATC_prefix = D01

| ATC_suffix = AC21

| ATC_supplemental =

| PubChem = 5282433

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = KVL61ZF9UO

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4445587

| ChEBI = 135281

| chemical_formula =

| C=17 | H=22 | N=2 | O=1 | S=1

| smiles = CCCCCOc1ccccc1/C(=C\SC)/n2ccnc2

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C17H22N2OS/c1-3-4-7-12-20-17-9-6-5-8-15(17)16(13-21-2)19-11-10-18-14-19/h5-6,8-11,13-14H,3-4,7,12H2,1-2H3/b16-13+

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = VWOIKFDZQQLJBJ-DTQAZKPQSA-N

}}

Neticonazole (INN) is an imidazole antifungal for the treatment of fungal skin infections.{{cite journal |vauthors=Nimura K, Niwano Y, Ishiduka S, Fukumoto R |title=Comparison of in vitro antifungal activities of topical antimycotics launched in 1990s in Japan |journal=Int. J. Antimicrob. Agents |volume=18 |issue=2 |pages=173–8 |date=August 2001 |pmid=11516941 |doi= 10.1016/S0924-8579(01)00365-X}}{{cite journal |vauthors=Tsuboi R, Matsumoto T, Ogawa H |title=Hyperkeratotic chronic tinea pedis treated with neticonazole cream. Neticonazole Study Group |journal=Int. J. Dermatol. |volume=35 |issue=5 |pages=371–3 |date=May 1996 |pmid=8734665 |doi= 10.1111/j.1365-4362.1996.tb03644.x|s2cid=34516725 }}

Neticonazole is only approved for use in Japan. It is sold as a topical ointment under the tradename Atolant.{{cn|date=December 2022}}