neurosporene

{{Chembox

| ImageFile = Neurosporene.png

| ImageSize = 300px

| IUPACName = 7,8-Dihydro-ψ,ψ-carotene

| SystematicName = (6E,8E,10E,12E,14E,16E,18E,20E,22E,26E)-2,6,10,14,19,23,27,31-Octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,26,30-dodecaene

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 502-64-7

| CASNo_Ref = {{cascite|correct|}}

| PubChem = 5280789

| ChEBI = 16833

| ChemSpiderID = 4444347

| SMILES = CC(=CCC/C(=C/CC/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C=C(\C)/CCC=C(C)C)/C)/C)/C)C

| InChI = 1/C40H58/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-17,19-22,25-31H,13-14,18,23-24,32H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+

| InChIKey = ATCICVFRSJQYDV-XILUKMICBV

| StdInChI = 1S/C40H58/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-17,19-22,25-31H,13-14,18,23-24,32H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+

| StdInChIKey = ATCICVFRSJQYDV-XILUKMICSA-N

}}

|Section2={{Chembox Properties

| C=40 | H=58

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Neurosporene is a carotenoid pigment. It is an intermediate in the biosynthesis of lycopene and a variety of bacterial carotenoids.{{Cite journal | pmid = 7358679 | year = 1980 | last1 = Scolnik | first1 = PA | last2 = Walker | first2 = MA | last3 = Marrs | first3 = BL | title = Biosynthesis of carotenoids derived from neurosporene in Rhodopseudomonas capsulata | volume = 255 | issue = 6 | pages = 2427–32 | journal = The Journal of Biological Chemistry| doi = 10.1016/S0021-9258(19)85909-4 | doi-access = free }}