nexeridine
{{Short description|Chemical compound}}
{{Distinguish|Meperidine}}
{{Drugbox
| IUPAC_name = 1-[1-(Dimethylamino)-2-propanyl]-2-phenylcyclohexyl acetate
| image = Nexeridine.svg
| CAS_number = 53716-48-6
| CAS_supplemental =
53716-47-5 (HCl)
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8CM77ZQ65K
| ATC_prefix = None
| ATC_suffix =
| PubChem = 10447719
| DrugBank =
| ChemSpiderID = 8623136
| chemical_formula =
| C=19 | H=29 | N=1 | O=2
| SMILES = CN(C)C[C@@H](C)[C@@]1(OC(=O)C)CCCC[C@H]1c1ccccc1
| StdInChI = 1S/C19H29NO2/c1-15(14-20(3)4)19(22-16(2)21)13-9-8-12-18(19)17-10-6-5-7-11-17/h5-7,10-11,15,18H,8-9,12-14H2,1-4H3
| StdInChIKey = TVQPXLMQOZWEBA-UHFFFAOYSA-N
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category=
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
}}
Nexeridine (INN; USAN: nexeridine hydrochloride; code name Compound 673-082) is an opioid analgesic with a similar structure to those of pethidine and tramadol.{{cite patent | country = US | number = 3974157 | title = 1-(Amino-alkyl)-2-aryl-cyclohexane alcohols and esters }}{{cite book| vauthors = Ganellin CR, Triggle DJ |title=Dictionary of Pharmacological Agents|url=https://books.google.com/books?id=A0THacd46ZsC&pg=PA1417|date=21 November 1996|publisher=CRC Press|isbn=978-0-412-46630-4|pages=1417–}}{{cite book| vauthors = Kar A |title=Medicinal Chemistry|url=https://books.google.com/books?id=07g30rxCA0EC&pg=PA268|date=1 January 2005|publisher=New Age International|isbn=978-81-224-1565-0|pages=268–269}}{{cite book|title=Unlisted Drugs, Volumes 27-28|url=https://books.google.com/books?id=9xZtAAAAMAAJ|year=1975|publisher=Pharmaceutical Section, Special Libraries Association.}} It was synthesized and assayed in 1975 but was never marketed. The active isomer is (1R,2S)-1-[(2R)-1-(dimethylamino)-2-propanyl]-2-phenylcyclohexyl acetate.{{cite web | title = (1R,2S)-1-[(2R)-1-(Dimethylamino)-2-propanyl]-2-phenylcyclohexyl acetate hydrochloride (1:1) | url = http://www.chemspider.com/Chemical-Structure.34995858.html | work = ChemSpider }}