niceritrol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447822020

| IUPAC_name = 3-[(pyridin-3-yl)carbonyloxy]-2,2-bis({[(pyridin-3-yl)carbonyloxy]methyl})propyl pyridine-3-carboxylate

| image = Niceritrol.png

| tradename =

| Drugs.com = {{drugs.com|international|niceritrol}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 5868-05-3

| ATC_prefix = C10

| ATC_suffix = AD01

| PubChem = 4476

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = F54EHJ34MV

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01754

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4321

| C=29 | H=24 | N=4 | O=8

| smiles = C1=CC(=CN=C1)C(=O)OCC(COC(=O)C2=CN=CC=C2)(COC(=O)C3=CN=CC=C3)COC(=O)C4=CN=CC=C4

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C29H24N4O8/c34-25(21-5-1-9-30-13-21)38-17-29(18-39-26(35)22-6-2-10-31-14-22,19-40-27(36)23-7-3-11-32-15-23)20-41-28(37)24-8-4-12-33-16-24/h1-16H,17-20H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = KUEUWHJGRZKESU-UHFFFAOYSA-N

}}

Niceritrol is a niacin derivative used as a hypolipidemic agent. It is an ester of pentaerythritol and nicotinic acid, has general properties similar to those of nicotinic acid (Nicotinamide), to which it is slowly hydrolysed. Niceritrol has been used as a lipid regulating drug in hyperlipidaemias and as a vasodilator in the treatment of peripheral vascular disease.{{cite journal | vauthors = Owada A, Suda S, Hata T | title = Antiproteinuric effect of niceritrol, a nicotinic acid derivative, in chronic renal disease with hyperlipidemia: a randomized trial | journal = The American Journal of Medicine | volume = 114 | issue = 5 | pages = 347–53 | date = April 2003 | pmid = 12714122 | doi = 10.1016/s0002-9343(02)01567-x | url = http://www.amjmed.com/article/S0002-9343(02)01567-X/abstract | url-access = subscription }}{{cite web|url=http://www.micromedexsolutions.com/micromedex2/librarian/ND_T/evidencexpert/ND_PR/evidencexpert/CS/CAA11B/ND_AppProduct/evidencexpert/DUPLICATIONSHIELDSYNC/10C889/ND_PG/evidencexpert/ND_B/evidencexpert/ND_P/evidencexpert/PFActionId/evidencexpert.IntermediateToDocumentLink?docId=9258-x&contentSetId=30&title=Niceritrol&servicesTitle=Niceritrol|title=Niceritrol|author=Truven Health Analytics Inc.|work=Micromedexsolutions.com|date=May 8, 2008|access-date=December 14, 2014}}

References

{{reflist}}

{{Lipid modifying agents}}

Category:Nicotinate esters

{{cardiovascular-drug-stub}}