nifenazone

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| IUPAC_name = N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)nicotinamide

| image = nifenazone.png

| image_class = skin-invert-image

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 2139-47-1

| ATC_prefix = M02

| ATC_suffix = AA24

| ATC_supplemental = {{ATC|N02|BB05}}

| PubChem = 4487

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1413176

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8780F0K71U

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01437

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4332

| C=17 | H=16 | N=4 | O=2

| smiles = c1ccccc1N2N(C)C(C)=C(C2=O)NC(=O)c3cccnc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H16N4O2/c1-12-15(19-16(22)13-7-6-10-18-11-13)17(23)21(20(12)2)14-8-4-3-5-9-14/h3-11H,1-2H3,(H,19,22)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = BRZANEXCSZCZCI-UHFFFAOYSA-N

}}

Nifenazone is a drug that has been used as an analgesic for a number of rheumatic conditions.{{cite journal | vauthors = Hart FD, Boardman PL | journal = British Medical Journal | volume = 1 | issue = 5397 | pages = 1553–4 | date = June 1964 | pmid = 14133613 | pmc = 1814611 | doi = 10.1136/bmj.1.5397.1553 | title = Trial of Nifenazone ("Thylin") }}