niguldipine

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 462260686

| ImageFile_Ref = {{chemboximage|correct|??}}

| ImageFile = File:Niguldipine structure.svg

| ImageSize = 250px

| IUPACName=3-3-(4,4-Diphenyl-1-piperidyl)propyl 5-methyl 2,6-dimethyl-4-(m-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate

| OtherNames=

|Section1={{Chembox Identifiers

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Z81N45O25Z

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 1199

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 41929

| InChI = 1/C36H39N3O6/c1-25-31(34(40)44-3)33(27-12-10-17-30(24-27)39(42)43)32(26(2)37-25)35(41)45-23-11-20-38-21-18-36(19-22-38,28-13-6-4-7-14-28)29-15-8-5-9-16-29/h4-10,12-17,24,33,37H,11,18-23H2,1-3H3

| InChIKey = SVJMLYUFVDMUHP-UHFFFAOYAB

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C36H39N3O6/c1-25-31(34(40)44-3)33(27-12-10-17-30(24-27)39(42)43)32(26(2)37-25)35(41)45-23-11-20-38-21-18-36(19-22-38,28-13-6-4-7-14-28)29-15-8-5-9-16-29/h4-10,12-17,24,33,37H,11,18-23H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = SVJMLYUFVDMUHP-UHFFFAOYSA-N

| CASNo2_Comment = (S)

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2 = 113165-32-5

| CASNo = 102993-22-6

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem= 1236

| SMILES = [O-][N+](=O)c1cccc(c1)C5C(/C(=O)OC)=C(\N\C(=C5\C(=O)OCCCN4CCC(c2ccccc2)(c3ccccc3)CC4)C)C

}}

|Section2={{Chembox Properties

| Formula=C₃₆H₃₉N₃O₆

| MolarMass=609.71136

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Niguldipine is a calcium channel blocker and α₁-adrenergic receptor antagonist.{{cite journal |vauthors=Boer R, Grassegger A, Schudt C, Glossmann H | title = (+)-Niguldipine binds with very high affinity to Ca2+ channels and to a subtype of alpha 1-adrenoceptors | journal = European Journal of Pharmacology | volume = 172 | issue = 2 | pages = 131–45 |date=May 1989 | pmid = 2548881 | doi = 10.1016/0922-4106(89)90004-7}}