nilvadipine
{{Short description|Antihypertensive drug of the calcium channel blocker class}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 459829456
| IUPAC_name = 3-Methyl 5-propan-2-yl 2-cyano-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
| image = Nilvadipine structure.svg
| tradename =
| Drugs.com = {{drugs.com|international|nilvadipine}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 75530-68-6
| ATC_prefix = C08
| ATC_suffix = CA10
| PubChem = 4494
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB06712
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0214FUT37J
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01908
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 517427
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4338
| C=19 | H=19 | N=3 | O=6
| smiles = CC1=C(C(C(=C(N1)C#N)C(=O)OC)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC(C)C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C19H19N3O6/c1-10(2)28-19(24)15-11(3)21-14(9-20)17(18(23)27-4)16(15)12-6-5-7-13(8-12)22(25)26/h5-8,10,16,21H,1-4H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = FAIIFDPAEUKBEP-UHFFFAOYSA-N
}}
Nilvadipine is a calcium channel blocker (CCB) used for the treatment of hypertension and chronic major cerebral artery occlusion.
Pathohistochemical studies have revealed that the volume of the infarction in the middle cerebral artery occlusion model could be decreased by nilvadipine.
Experimental research
{{third-party|section|date=December 2017}}
Nilvadipine was tested in clinical trial as a possible treatment for Alzheimer's disease in Ireland by the Roskamp Institute, Florida, USA and Trinity College, Ireland.{{cite press release | url = http://www.rfdn.org/news_release_090806_faq.html | publisher = Roskamp Institute | title = Roskamp Nilvadipine Clinical Trial Questions and Answers | access-date = 2007-10-07 | archive-date = 2007-10-22 | archive-url = https://web.archive.org/web/20071022110143/http://rfdn.org/news_release_090806_faq.html | url-status = dead }} Following this study, an international research consortium led by Trinity College Dublin (Ireland) in May 2011 announced the selection for funding of a large-scale European clinical trial of nilvadipine. More than 500 Alzheimer's disease patients will participate in the multicenter phase III clinical trial designed to study the effectiveness of nilvadipine.{{cite press release | url = http://www.rfdn.org/news_release_052511.html | publisher = Roskamp Institute | title = Roskamp Nilvadipine Clinical Trial Press Release | access-date = 2011-06-16 | archive-date = 2015-06-01 | archive-url = https://web.archive.org/web/20150601231804/http://www.rfdn.org/news_release_052511.html | url-status = dead }}{{update inline|date=December 2017}} In 2018, researchers analyzing data from the trial came to the conclusion that treatment with nilvadipine did not benefit the trial participants, who had suffered from mild to moderate Alzheimer disease.{{cite journal | vauthors = Lawlor B, Segurado R, Kennelly S, Olde Rikkert MG, Howard R, Pasquier F, Börjesson-Hanson A, Tsolaki M, Lucca U, Molloy DW, Coen R, Riepe MW, Kálmán J, Kenny RA, Cregg F, O'Dwyer S, Walsh C, Adams J, Banzi R, Breuilh L, Daly L, Hendrix S, Aisen P, Gaynor S, Sheikhi A, Taekema DG, Verhey FR, Nemni R, Nobili F, Franceschi M, Frisoni G, Zanetti O, Konsta A, Anastasios O, Nenopoulou S, Tsolaki-Tagaraki F, Pakaski M, Dereeper O, de la Sayette V, Sénéchal O, Lavenu I, Devendeville A, Calais G, Crawford F, Mullan M | title = Nilvadipine in mild to moderate Alzheimer disease: A randomised controlled trial | journal = PLOS Medicine | volume = 15 | issue = 9 | pages = e1002660 | date = September 2018 | pmid = 30248105 | pmc = 6152871 | doi = 10.1371/journal.pmed.1002660 | doi-access = free }}
References
{{Reflist}}
{{Ion channel modulators}}
{{Xenobiotic-sensing receptor modulators}}
Category:Calcium channel blockers
Category:3-Nitrophenyl compounds
{{Cardiovascular-drug-stub}}