nimustine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 444554365

| IUPAC_name = N'-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-(2-chloroethyl)-N-nitrosourea

| image = Nimustine.svg

| alt = Structural formula of Nimustine

| width = 225px

| image2 = Nimustine 3D spacefill.png

| alt2 = Space-filling model of the nimustine molecule

| width2 = 225px

| tradename =

| Drugs.com = {{drugs.com|international|nimustine}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = Intravenous

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 42471-28-3

| ATC_prefix = L01

| ATC_suffix = AD06

| ATC_supplemental =

| PubChem = 39214

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0S726V972K

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08276

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 75270

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 35876

| C=9 | H=13 | Cl=1 | N=6 | O=2

| SMILES = CC1=NC=C(C(=N1)N)CNC(=O)N(CCCl)N=O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C9H13ClN6O2/c1-6-12-4-7(8(11)14-6)5-13-9(17)16(15-18)3-2-10/h4H,2-3,5H2,1H3,(H,13,17)(H2,11,12,14)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = VFEDRRNHLBGPNN-UHFFFAOYSA-N

}}

Nimustine ({{abbrlink|INN|International Nonproprietary Name}}) is a nitrosourea alkylating agent.{{Cite web|url=https://www.cancer.gov/publications/dictionaries/cancer-drug/def/nimustine|title=NCI Drug Dictionary|website=National Cancer Institute|language=en|access-date=2019-03-17}}

It is used to treat malignant brain tumors and has proven to be rather effective.[https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:75270 CHEBI:75270 - nimustine] {{cite journal | vauthors = Endo T, Inoue T, Sugiyama S, Saito R, Tominaga T | title = Regression of Recurrent Spinal Cord High-Grade Glioma After Convection-Enhanced Delivery of Nimustine Hydrochloride: Case Reports and Literature Review | journal = Operative Neurosurgery (Hagerstown, Md.) | volume = 18 | issue = 4 | pages = 451–459 | date = April 2020 | pmid = 31414134 | doi = 10.1093/ons/opz172 }}