niravoline

{{Chembox

| ImageFile = Niravoline.svg

| ImageSize = 200px

| PIN = N-Methyl-2-(3-nitrophenyl)-N-[(1S,2S)-2-(pyrrolidin-1-yl)-2,3-dihydro-1H-inden-1-yl]acetamide

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 130610-93-4

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChEMBL = 2105162

| ChemSpiderID = 7996923

| PubChem = 9821174

| UNII = R8T17Q4LXC

| SMILES = CN([C@@H]1[C@H](CC2=CC=CC=C12)N3CCCC3)C(=O)CC4=CC(=CC=C4)[N+](=O)[O-]

| InChI=1S/C22H25N3O3/c1-23(21(26)14-16-7-6-9-18(13-16)25(27)28)22-19-10-3-2-8-17(19)15-20(22)24-11-4-5-12-24/h2-3,6-10,13,20,22H,4-5,11-12,14-15H2,1H3/t20-,22-/m0/s1

| InChIKey=ZSDAQBWGAOKTSI-UNMCSNQZSA-N

}}

| Section2 = {{Chembox Properties

| C=22|H=25|N=3|O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Niravoline is a chemical compound with the formula {{chem|C|22|H|25|N|3|O|3}}.{{PubChem|9821174}} It has diuretic and aquaretic effects and has been studied for its potential use for cerebral edema{{Cite journal | pmid = 9223533 | year = 1997 | last1 = Guéniau | first1 = C. | title = The kappa opioid agonist niravoline decreases brain edema in the mouse middle cerebral artery occlusion model of stroke | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 282 | issue = 1 | pages = 1–6 | last2 = Oberlander | first2 = C. }} and cirrhosis.{{Cite journal | pmid = 10673065 | year = 2000 | last1 = Gadano | first1 = A. | title = Aquaretic effects of niravoline, a kappa-opioid agonist, in patients with cirrhosis | journal = Journal of Hepatology | volume = 32 | issue = 1 | pages = 38–42 | last2 = Moreau | first2 = R. | last3 = Pessione | first3 = F. | last4 = Trombino | first4 = C. | last5 = Giuily | first5 = N. | last6 = Sinnassamy | first6 = P. | last7 = Valla | first7 = D. | last8 = Lebrec | first8 = D. | doi = 10.1016/S0168-8278(00)80187-7 }}

It exerts its pharmacological effect as a kappa opioid receptor agonist.{{Cite web | url = https://evsexplore.semantics.cancer.gov/evsexplore/concept/ncit/C91012 | title = Niravoline | work = NCI Thesaurus | publisher = National Cancer Institute }}