nitecapone

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 3-[(3,4-Dihydroxy-5-nitrophenyl)methylidene]pentane-2,4-dione

| image = Nitecapone.svg

| alt = Skeletal formula

| width = 200

| image2 = Nitecapone molecule spacefill.png

| alt2 = Space-filling model

| CAS_number = 116313-94-1

| CAS_supplemental =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 5464105

| ChemSpiderID = 4576539

| KEGG = D03241

| UNII = 98BS722498

| ChEMBL = 167055

| C=12 | H=11 | N=1 | O=6

| SMILES = [O-][N+](=O)c1cc(\C=C(/C(=O)C)C(=O)C)cc(O)c1O

| StdInChI = 1S/C12H11NO6/c1-6(14)9(7(2)15)3-8-4-10(13(18)19)12(17)11(16)5-8/h3-5,16-17H,1-2H3

| StdInChIKey = UPMRZALMHVUCIN-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration =

}}

Nitecapone (INN; OR-462) is a drug which acts as a selective inhibitor of the enzyme catechol O-methyl transferase (COMT).{{cite book | author = F.. Macdonald | title = Dictionary of Pharmacological Agents | url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1435 | access-date = 20 May 2012 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 1635}}{{cite journal |vauthors=Nissinen E, Lindén IB, Schultz E, Kaakkola S, Männistö PT, Pohto P | title = Inhibition of catechol-O-methyltransferase activity by two novel disubstituted catechols in the rat | journal = European Journal of Pharmacology | volume = 153 | issue = 2–3 | pages = 263–9 |date=August 1988 | pmid = 3181288 | doi = 10.1016/0014-2999(88)90614-0}} It was patented as an antiparkinson medication but was never marketed.