nitrafudam

{{Short description|Antidepressant compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name = Nitrafudam

| image = Nitrafudam.svg

| width = 250px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 64743-09-5

| PubChem = 163304

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 143312

| UNII = 7R3267A08Y

| KEGG =

| ChEBI =

| ChEMBL = 2111024

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| C=11 | H=9 | N=3 | O=3

| StdInChI=1S/C11H9N3O3/c12-11(13)10-6-5-9(17-10)7-3-1-2-4-8(7)14(15)16/h1-6H,(H3,12,13)

| StdInChIKey = FYUZOMGBPKUZNJ-UHFFFAOYSA-N

| SMILES = C1=CC=C(C(=C1)C2=CC=C(O2)C(=N)N)[N+](=O)[O-]

}}

Nitrafudam is an antidepressant compound that was developed in the 1970-1980s.{{cite journal | vauthors = Pong SF, Pelosi SS, Wessels FL, Yu CN, Burns RH, White RE, Anthony DR, Ellis KO, Wright GC, White RL | title = 5-phenyl-2-furamidines: a new chemical class of potential antidepressants | journal = Arzneimittel-Forschung | volume = 33 | issue = 10 | pages = 1411–1416 | year = 1983 | pmid = 6140016 }}{{cite patent |country=US |number=3919231 |inventor=Pelosi SS Jr, White RE, White RL Jr, Wright GC, You CN |gdate=1975 |assign=Morton Norwich Products Inc |url=https://patents.google.com/patent/US3919231A/en?oq=US3919231}} It contains three functional groups: a nitrobenzene, a furan ring and an amidine.