nitroscanate

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 444437587

| IUPAC_name = 1-(4-Isothiocyanatophenoxy)-4-nitrobenzene

| image = Nitroscanate.png

| alt = Skeletal formula

| width = 240

| image2 = Nitroscanate-3D-spacefill.png

| alt2 = Space-filling model

| tradename = Lopatol

| Drugs.com = {{drugs.com|international|nitroscanate}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 19881-18-6

| ATCvet = yes

| ATC_prefix = P52

| ATC_suffix = AX01

| PubChem =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID = 61821

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = P4IE5B6D6U

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D05193

| C=13 | H=8 | N=2 | O=3 | S=1

| smiles = C1=CC(=CC=C1N=C=S)OC2=CC=C(C=C2)[N+](=O)[O-]

| StdInChI=1S/C13H8N2O3S/c16-15(17)11-3-7-13(8-4-11)18-12-5-1-10(2-6-12)14-9-19/h1-8H

| StdInChIKey = SVMGVZLUIWGYPH-UHFFFAOYSA-N

}}

Nitroscanate (trade name Lopatol) is an anthelmintic drug used in veterinary medicine to treat Toxocara canis, Toxascaris leonina, Ancylostoma caninum, Uncinaria stenocephala, Taenia, and Dipylidium caninum (roundworms, hookworms and tapeworms).{{cite web|url=https://elanco.cvpservice.com/product/basic/view/1231018|title=Lopatol (package insert)|publisher=Elanco|access-date=29 October 2020}}{{cite journal | vauthors = Craig TM, Mercer SH, Wade CG, Lynn RC | title = Efficacy of nitroscanate against naturally acquired infection with Ancylostoma caninum, Dipylidium caninum, and Trichuris vulpis in dogs | journal = American Journal of Veterinary Research | volume = 52 | issue = 4 | pages = 574–5 | date = April 1991 | pmid = 2053726 }}