nitrosonium octafluoroxenate(VI)

{{Chembox

| Watchedfields = changed

| verifiedrevid = 442017793

| ImageFileR1 =Nitrosonium-3D-vdW.png

| ImageFileL1 =Nitrosonium-3D-vdW.png

| ImageFile = Octafluoroxenate(VI)-3D-balls-A.png

| ImageAlt=A greenish-blue central atom surrounded by and bonded to eight yellowish-green atoms arranged in a square antiprismatic fashion.

| ImageCaption = The square antiprismatic [XeF₈]²⁻ anion in (NO)₂XeF₈{{Cite journal | first3 = A.| first2 = H. | first4 = M.| title = Antiprismatic Coordination about Xenon: the Structure of Nitrosonium Octafluoroxenate(VI)| first1 = W.| last2 = Holloway| last3 = Coyle| volume = 173| journal = Science| issue = 4003| pages = 1238–1239| issn = 0036-8075| doi = 10.1126/science.173.4003.1238| last4 = Williams| pmid = 17775218| last1 = Peterson| date = Sep 1971|bibcode = 1971Sci...173.1238P | s2cid = 22384146 }}

| ImageSize =

| IUPACName = Nitrosonium octafluoroxenate(VI)

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo =

| PubChem =

| StdInChI=1S/F8Xe.2NO/c1-9(2,3,4,5,6,7)8;2*1-2/q-2;2*+1

| StdInChIKey=UZLZIYXSQHCOGO-UHFFFAOYSA-N

| SMILES = [N]#[O+].[N]#[O+].F[Xe-2](F)(F)(F)(F)(F)(F)[F]}}

|Section2={{Chembox Properties

| Formula = {{chem|(NO)|2|XeF|8}}

| MolarMass =

| Appearance =

| Density = 3.354 g/cm³

| MeltingPt =

| BoilingPt =

| Solubility = Reacts}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Nitrosonium octafluoroxenate(VI) is a chemical compound of xenon with nitrogen, oxygen, and fluorine, having formula {{chem|(NO)|2|XeF|8}}. It is an ionic compound containing well-separated nitrosonium cations (NO⁺) and octafluoroxenate(VI) anions ({{chem|XeF|8|2-}}). The molecular geometry of the octafluoroxenate(VI) ion is square antiprismatic, having Xe–F bond lengths of 1.971 Å, 1.946 Å, 1.958 Å, 2.052 Å, and 2.099 Å.

It is synthesized by the reaction of xenon hexafluoride ({{chem|XeF|6}}) with nitrosyl fluoride (NOF):{{cite book

| title = Advanced Inorganic Chemistry

| edition = 6th

| author = Cotton

| publisher = Wiley-India

| year = 2007

| isbn = 978-81-265-1338-3

| page = 588

}}

:{{chem|XeF|6}} + 2 NOF → {{chem|(NO)|2|XeF|8}}

Other compounds containing the octafluoroxenate(VI) ion include its alkali metal salts, including Cs₂XeF₈ and Rb₂XeF₈, which are stable up to 400 °C.{{cite book

| title = Comprehensive Inorganic Chemistry

| first1 = Sulekh

| last1 = Chandra

| publisher = New Age International

| year = 2004

| isbn = 81-224-1512-1

| page = 308

}}{{cite book

| last1 = Holleman

| first1 = A. F.

| last2 = Wiberg

| first2 = E.

| title = Inorganic Chemistry

| publisher = Academic Press

| location = San Diego

| year = 2001

| isbn = 0-12-352651-5

}}