nopaline
{{chembox
| ImageFile = Nopaline.svg
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageName = Stereo, skeletal formula of nopaline
| IUPACName = (2R)-2-
| OtherNames = N2-(D-1,3-Dicarboxypropyl)-L-arginine
|Section1={{Chembox Identifiers
| CASNo = 22350-70-5
| CASNo_Ref = {{Cascite|changed|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = QJ8EP5F7X8
| ChEBI = 17249
| DTXSID = DTXSID20945005
| KEGG = C01682
| PubChem = 108012
| ChemSpiderID = 19976727
| SMILES = C(C[C@@H](C(=O)O)N[C@H](CCC(=O)O)C(=O)O)CN=C(N)N
| StdInChI = 1S/C11H20N4O6/c12-11(13)14-5-1-2-6(9(18)19)15-7(10(20)21)3-4-8(16)17/h6-7,15H,1-5H2,(H,16,17)(H,18,19)(H,20,21)(H4,12,13,14)/t6-,7+/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LMKYZBGVKHTLTN-NKWVEPMBSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
|Section2={{Chembox Properties
| C=11 | H=20 | N=4 | O=6
}}
|Section3={{Chembox Related
| OtherFunction_label = opines
| OtherFunction = Octopine
}}
}}
Nopaline is a chemical compound derived from the amino acids glutamic acid and arginine. It is classified as an opine. Ti plasmids are classified on the basis of the different types of opines they produce.{{Cite journal | pmid = 7153689| year = 1982| last1 = Depicker| first1 = A.| title = Nopaline synthase: Transcript mapping and DNA sequence| journal = Journal of Molecular and Applied Genetics| volume = 1| issue = 6| pages = 561–73| last2 = Stachel| first2 = S.| last3 = Dhaese| first3 = P.| last4 = Zambryski| first4 = P.| last5 = Goodman| first5 = H. M.}} These may be nopaline plasmids, octopine plasmids and agropine plasmids. These opines are condensation products of amino acids and keto acids or may be derived from sugars. The opines are used as carbon and nitrogen sources and metabolized by Agrobacterium.