norvinisterone

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (8R,9S,10R,13S,14S,17R)-17-ethenyl-17-hydroxy-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one

| image = Norvinisterone.svg

| width = 225px

| tradename = Neoprogestin, Nor-Progestelea

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| class = Progestogen; Progestin; Androgen; Anabolic steroid

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 6795-60-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7Q843V12Q0

| ATC_prefix = None

| ATC_suffix =

| PubChem = 65588

| ChemSpiderID = 59030

| DrugBank =

| synonyms = Vinylnortestosterone; SC-4641; 17α-Vinyl-19-nortestosterone; 17α-Vinylestr-4-en-17β-ol-3-one

| C=20 | H=28 | O=2

| SMILES = O=C4\C=C2/[C@@H]([C@H]1CC[C@@]3([C@](O)(\C=C)CC[C@H]3[C@@H]1CC2)C)CC4

| StdInChI = 1S/C20H28O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h3,12,15-18,22H,1,4-11H2,2H3/t15-,16+,17+,18-,19-,20-/m0/s1

| StdInChIKey = VOJYZDFYEHKHAP-XGXHKTLJSA-N

| melting_point = 169

| melting_high = 171

| melting_notes = {{cite book | veditors = Budavari S | chapter = 6637: Norvinisterone | title = Merck Index | edition = 11th | date = 1989 | isbn = 978-0-911910-28-5 | publisher = Merck & Co. | location = Rahway, N.J. }}

}}

Norvinisterone, sold under the brand names Neoprogestin and Nor-Progestelea, is a progestin and androgen/anabolic steroid (AAS) medication which was used in Europe but is now no longer marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA889|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=889–}}{{cite book| vauthors = Juo PS |title=Concise Dictionary of Biomedicine and Molecular Biology|url=https://books.google.com/books?id=Y4DLBQAAQBAJ&pg=PA774|date=21 December 2001|publisher=CRC Press|isbn=978-1-4200-4130-9|pages=774–}}{{cite book | vauthors = List PH, Hörhammer L |title=Chemikalien und Drogen Teil A: N-Q|url=https://books.google.com/books?id=4TWnBgAAQBAJ&pg=PA274|date=12 March 2013|publisher=Springer Berlin Heidelberg|isbn=978-3-642-65035-2|pages=274–}}{{cite journal | vauthors = Meyerson BJ | title = Relationship between the anesthetic and gestagenic action and estrous behavior-inducing activity of different progestins | journal = Endocrinology | volume = 81 | issue = 2 | pages = 369–374 | date = August 1967 | pmid = 4952012 | doi = 10.1210/endo-81-2-369 }} It is taken by mouth.

Norvinisterone is a progestin, or a synthetic progestogen, and hence is an agonist of the progesterone receptor, the biological target of progestogens like progesterone. It has androgenic activity.

Norvinisterone was synthesized in 1953. It is no longer available.