o-Dianisidine

{{DISPLAYTITLE:o-Dianisidine}}

{{Chembox

| ImageFile = Dianisidine.svg

| ImageSize =

| ImageAlt =

| PIN = 3,3′-Dimethoxy[1,1′-biphenyl]-4,4′-diamine

| OtherNames = 3,3'-dimethoxy-4,4’-benzidine

|Section1={{Chembox Identifiers

| CASNo = 119-90-4

| PubChem = 8411

| EC_number = 204-355-4

| RTECS = DD0875000

| UNNumber = 2811, 2431, 3077

| UNII = MJY508JZXV

| ChEBI = 82321

| ChEMBL = 398363

| KEGG = C19231

| ChemSpiderID = 8104

| InChI=1S/C14H16N2O2/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2/h3-8H,15-16H2,1-2H3

| InChIKey = JRBJSXQPQWSCCF-UHFFFAOYSA-N

| SMILES = COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)OC)N }}

|Section2={{Chembox Properties

| C=14|H=16|N=2|O=2

| MolarMass =

| Appearance = White solid

| Density = 1.178 g/cm³

| MeltingPtC = 113

| BoilingPtC = 356

| Solubility = 60 mg/L }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt = 206°C

| GHSPictograms = {{GHS07}}{{GHS08}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|302|350}}

| PPhrases = {{P-phrases|201|202|264|270|281|301+312|308+313|330|405|501}}

| AutoignitionPt = }}

}}

o-Dianisidine is an organic compound with the formula [(CH₃O)(H₂N)C₆H₃]₂. A colorless or white solid, it is a bifunctional compound derived via the benzidine rearrangement from o-anisidine.

o-Dianisidine is a precursor to some azo dyes by formation of the bis(diazonium) derivative, which is coupled to diverse aromatic compounds. Some commercial dyes derived from o-dianisidine include C. I. Direct Blue 1, 15, 22, 84, and 98.{{cite encyclopedia|author1=Klaus Hunger|author2=Peter Mischke|author3=Wolfgang Rieper|author4=Roderich Raue|author5=Klaus Kunde|author6=Aloys Engel|title=Azo Dyes|encyclopedia=Ullmann’s Encyclopedia of Industrial Chemistry|year=2005|publisher=Wiley-VCH|place=Weinheim|doi=10.1002/14356007.a03_245|isbn=3527306730 }}.

o-Dianisidine is also used in assaying activity of peroxidase in lab. The general reaction of a peroxidase is as follows.

:ROOR' + \overset{electron\atop donor}{2e^-} + 2H+ ->[\ce{Peroxidase}] {ROH} + R'OH

Where the ROOR' can be hydrogen peroxide, and the electron donor be o-dianisidine.

Image:Pontamine sky blue.svg is commercial dye, a derivative of o-dianisidine.]]