o-Nitroanisole

{{DISPLAYTITLE:o-Nitroanisole}}

{{Chembox

| Name = o-Nitroanisole

| ImageFile = O-nitroanisole.svg

| ImageSize = 144

| ImageAlt =

| PIN = 1-Methoxy-2-nitrobenzene

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 91-23-6

| PubChem = 7048

| EC_number = 202-052-1

| RTECS = BZ8790000

| UNNumber = 2730

| UNII = ZRE7HLZ17K

| ChEBI = 48722

| ChEMBL = 166415

| Beilstein = 1868032

| ChemSpiderID = 6781

| KEGG = C19270

| InChI=1S/C7H7NO3/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3

| InChIKey = CFBYEGUGFPZCNF-UHFFFAOYSA-N

| SMILES = COC1=CC=CC=C1[N+](=O)[O-] }}

|Section2={{Chembox Properties

| C=7|H=7|O=3|N=1

| MolarMass =

| Appearance = Colorless liquid

| Density = 1.2540 g/cm³

| MeltingPtC = 10

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

o-Nitroanisole is an organic compound with the formula CH₃OC₆H₄NO₂. Three isomers of nitroanisole exist, but the o-isomer is the most commercially important. It is a colorless liquid.

It is prepared by treatment of o-chloronitrobenzene with sodium methoxide:{{cite encyclopedia|author=Gerald Booth|title=Nitro Compounds, Aromatic|encyclopedia=Ullmann's Encyclopedia of Industrial Chemistry|year=2007|publisher=Wiley-VCH|location=Weinheim|doi=10.1002/14356007.a17_411|isbn=978-3527306732}}

:NaOCH₃ + ClC₆H₄NO₂ → CH₃OC₆H₄NO₂ + NaCl

The resulting 2-chloronitrobenzene can be reduced to o-anisidine, which is a precursor to dyes.