ocaperidone

{{Chembox

| ImageFile = Ocaperidone.svg

| ImageClass = skin-invert-image

| ImageSize = 300

| ImageAlt =

| PIN = 3-{2-[4-(6-Fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl}-2,9-dimethyl-4H-pyrido[1,2-a]pyrimidin-4-one

| OtherNames =

|Section1 = {{Chembox Identifiers

| IUPHAR_ligand = 46

| CASNo = 129029-23-8

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 26HUS7139V

| PubChem = 71351

| ChemSpiderID = 64451

| InChI = 1/C24H25FN4O2/c1-15-4-3-10-29-23(15)26-16(2)19(24(29)30)9-13-28-11-7-17(8-12-28)22-20-6-5-18(25)14-21(20)31-27-22/h3-6,10,14,17H,7-9,11-13H2,1-2H3

| InChIKey = ZZQNEJILGNNOEP-UHFFFAOYAT

| StdInChI = 1S/C24H25FN4O2/c1-15-4-3-10-29-23(15)26-16(2)19(24(29)30)9-13-28-11-7-17(8-12-28)22-20-6-5-18(25)14-21(20)31-27-22/h3-6,10,14,17H,7-9,11-13H2,1-2H3

| StdInChIKey = ZZQNEJILGNNOEP-UHFFFAOYSA-N

| RTECS =

| MeSHName = C072259

| ChEBI =

| KEGG = D02675

| SMILES = CC1=CC=CN2C1=NC(=C(C2=O)CCN3CCC(CC3)C4=NOC5=C4C=CC(=C5)F)C}}

|Section2 = {{Chembox Properties

| C=24 | H=25 | F=1 | N=4 | O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Ocaperidone (R 79598) is a benzisoxazole antipsychotic.{{cite journal|pmid=1372084|year=1992|last1=Leysen|first1=JE|last2=Janssen|first2=PM|last3=Gommeren|first3=W|last4=Wynants|first4=J|last5=Pauwels|first5=PJ|last6=Janssen|first6=PA|title=In vitro and in vivo receptor binding and effects on monoamine turnover in rat brain regions of the novel antipsychotics risperidone and ocaperidone|volume=41|issue=3|pages=494–508|journal=Molecular Pharmacology}} It was initially developed by Janssen, later licensed to French laboratory Neuro3D and then acquired in 2007 by German company Evotec. It was found to be more potent than risperidone in animal studies,Megens AA, Awouters FH, Meert TF, Schellekens KH, Niemegeers CJ, Janssen PA. Pharmacological profile of the new potent neuroleptic ocaperidone (R 79,598). J Pharmacol Exp Ther. 1992 Jan;260(1):146-59. {{PMID|1370538}} but its testing was abandoned in 2010 after unfavorable results in human Phase II trials,{{cite web|title=Ocaperidone — AdisInsight|url=http://adisinsight.springer.com/drugs/800001114|website=Adis Insight|publisher=Adis International Ltd, part of Springer Science+Business Media|access-date=10 December 2015}} as while it was effective at controlling symptoms of schizophrenia, ocaperidone produced an unacceptable amount of extrapyramidal side effects.{{cite journal | doi = 10.1371/journal.pone.0049732 | doi-access = free | pmid = 23251349 | title = Blinded Prospective Evaluation of Computer-Based Mechanistic Schizophrenia Disease Model for Predicting Drug Response | date = 2012 | last1 = Geerts | first1 = Hugo | last2 = Spiros | first2 = Athan | last3 = Roberts | first3 = Patrick | last4 = Twyman | first4 = Roy | last5 = Alphs | first5 = Larry | last6 = Grace | first6 = Anthony A. | journal = PLOS ONE | volume = 7 | issue = 12 | pages = e49732 | pmc = 3522663 | bibcode = 2012PLoSO...749732G }}