orelabrutinib
{{Short description|Drug for treatment of cancer}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name = Orelabrutinib
| INN =
| type =
| image = Orelabrutinib.svg
| alt =
| caption =
| pronounce =
| tradename = 宜诺凯
| Drugs.com =
| MedlinePlus =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category=
| routes_of_administration =
| ATC_prefix = L01
| ATC_suffix = EL04
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US =
| legal_US_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status = Rx-only
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action=
| excretion =
| synonyms = ICP-022; ICP022
| CAS_number = 1655504-04-3
| PubChem = 91667513
| ChemSpiderID = 82956396
| IUPHAR_ligand = 10629
| UNII = WJA5UO9E10
| ChEMBL = 4650321
| DrugBank = DB16272
| IUPAC_name = 2-(4-Phenoxyphenyl)-6-(1-prop-2-enoylpiperidin-4-yl)pyridine-3-carboxamide
| C = 26 | H = 25 | N = 3 | O = 3
| StdInChI=1S/C26H25N3O3/c1-2-24(30)29-16-14-18(15-17-29)23-13-12-22(26(27)31)25(28-23)19-8-10-21(11-9-19)32-20-6-4-3-5-7-20/h2-13,18H,1,14-17H2,(H2,27,31)
| StdInChIKey = MZPVEMOYADUARK-UHFFFAOYSA-N
| SMILES = C=CC(=O)N1CCC(CC1)C2=NC(=C(C=C2)C(=O)N)C3=CC=C(C=C3)OC4=CC=CC=C4
}}
Orelabrutinib is a drug for the treatment of cancer.
In China, it is approved for patients with mantle cell lymphoma (MCL) and chronic lymphocytic leukemia/small lymphocytic lymphoma (CLL/SLL), who have received at least one treatment in the past.{{cite journal | vauthors = Dhillon S | title = Orelabrutinib: First Approval | journal = Drugs | volume = 81 | issue = 4 | pages = 503–507 | date = March 2021 | pmid = 33704654 | doi = 10.1007/s40265-021-01482-5 }}
Orelabrutinib is an inhibitor of Bruton's tyrosine kinase.{{cite journal | vauthors = Deng LJ, Zhou KS, Liu LH, Zhang MZ, Li ZM, Ji CY, Xu W, Liu T, Xu B, Wang X, Gao SJ, Zhang HL, Hu Y, Li Y, Cheng Y, Yang HY, Cao JN, Zhu ZM, Hu JD, Zhang W, Jing HM, Ding KY, Zhang XY, Zhao RB, Zhang B, Tian YM, Song YP, Song YQ, Zhu J | title = Orelabrutinib for the treatment of relapsed or refractory MCL: a phase 1/2, open-label, multicenter, single-arm study | journal = Blood Advances | volume = 7 | issue = 16 | pages = 4349–4357 | date = August 2023 | pmid = 37078706 | pmc = 10432605 | doi = 10.1182/bloodadvances.2022009168 }}
References
{{reflist}}
{{Targeted cancer therapeutic agents}}
Category:Antineoplastic and immunomodulating drugs
{{antineoplastic-drug-stub}}