orestrate
{{short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = [(8R,9S,13S,14S,17S)-17-(Cyclohexen-1-yloxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] propanoate
| image = Orestrate.svg
| width = 250px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| class = Estrogen; Estrogen ester
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 13885-31-9
| CAS_supplemental =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = G9VC23W7W0
| ATC_prefix =
| ATC_suffix =
| PubChem = 20055348
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 16736660
| synonyms = Estradiol 3-propionate 17β-(1-cyclohexenyl) ether; 17β-(Cyclohexen-1-yloxy)-estra-1,3,5(10)-trien-3-ol propionate
| C=27 | H=36 | O=3
| SMILES = CCC(=O)OC1=CC2=C(C=C1)C3CCC4(C(C3CC2)CCC4OC5=CCCCC5)C
| StdInChI = 1S/C27H36O3/c1-3-26(28)30-20-10-12-21-18(17-20)9-11-23-22(21)15-16-27(2)24(23)13-14-25(27)29-19-7-5-4-6-8-19/h7,10,12,17,22-25H,3-6,8-9,11,13-16H2,1-2H3/t22-,23-,24+,25+,27+/m1/s1
| StdInChIKey = VYAXJSIVAVEVHF-RYIFMDQWSA-N
}}
Orestrate ({{abbrlink|INN|International Nonproprietary Name}}), also known as estradiol 3-propionate 17β-(1-cyclohexenyl) ether, is an estrogen medication and estrogen ester which was never marketed.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA905|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=898, 905}}{{cite journal | vauthors = Gardi R, Vitali R, Falconi G, Ercoli A | title = 1,3,5(10)-Estratrien-17 -yl enol ethers and acetals. New classes of orally and parenterally active estrogenic derivatives | journal = Journal of Medicinal Chemistry | volume = 16 | issue = 2 | pages = 123–127 | date = February 1973 | pmid = 4683106 | doi = 10.1021/jm00260a009 }}{{cite journal | vauthors = Galletti F, Gardi R | title = Effect of two orally active estradiol derivatives on sulfobromphthalein retention in rats | journal = Pharmacological Research Communications | volume = 6 | issue = 2 | pages = 135–145 | date = April 1974 | pmid = 4438394 | doi = 10.1016/s0031-6989(74)80021-4 }}{{cite book | vauthors = List PH, Hörhammer L | chapter = Orestratum |title=Chemikalien und Drogen Teil A: N-Q| chapter-url = https://books.google.com/books?id=4TWnBgAAQBAJ&pg=PA331 |date=12 March 2013|publisher=Springer-Verlag|isbn=978-3-642-65035-2|pages=331–}}{{cite book| vauthors = Roche EB, ((Academy of Pharmaceutical Sciences, ((Medicinal Chemistry Section)) |title=Design of biopharmaceutical properties through prodrugs and analogs: a symposium|url=https://books.google.com/books?id=T7zwAAAAMAAJ|year=1977|publisher=The Academy|isbn=978-0-917330-16-2|page=7}} It is the C3 propionate ester and C17β-(1-cyclohexenyl) ether of estradiol.
See also
References
{{Reflist}}
{{Estrogen receptor modulators}}
{{Genito-urinary-drug-stub}}
{{Steroid-stub}}