orestrate

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,13S,14S,17S)-17-(Cyclohexen-1-yloxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] propanoate

| image = Orestrate.svg

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Estrogen; Estrogen ester

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 13885-31-9

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = G9VC23W7W0

| ATC_prefix =

| ATC_suffix =

| PubChem = 20055348

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 16736660

| synonyms = Estradiol 3-propionate 17β-(1-cyclohexenyl) ether; 17β-(Cyclohexen-1-yloxy)-estra-1,3,5(10)-trien-3-ol propionate

| C=27 | H=36 | O=3

| SMILES = CCC(=O)OC1=CC2=C(C=C1)C3CCC4(C(C3CC2)CCC4OC5=CCCCC5)C

| StdInChI = 1S/C27H36O3/c1-3-26(28)30-20-10-12-21-18(17-20)9-11-23-22(21)15-16-27(2)24(23)13-14-25(27)29-19-7-5-4-6-8-19/h7,10,12,17,22-25H,3-6,8-9,11,13-16H2,1-2H3/t22-,23-,24+,25+,27+/m1/s1

| StdInChIKey = VYAXJSIVAVEVHF-RYIFMDQWSA-N

}}

Orestrate ({{abbrlink|INN|International Nonproprietary Name}}), also known as estradiol 3-propionate 17β-(1-cyclohexenyl) ether, is an estrogen medication and estrogen ester which was never marketed.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA905|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=898, 905}}{{cite journal | vauthors = Gardi R, Vitali R, Falconi G, Ercoli A | title = 1,3,5(10)-Estratrien-17 -yl enol ethers and acetals. New classes of orally and parenterally active estrogenic derivatives | journal = Journal of Medicinal Chemistry | volume = 16 | issue = 2 | pages = 123–127 | date = February 1973 | pmid = 4683106 | doi = 10.1021/jm00260a009 }}{{cite journal | vauthors = Galletti F, Gardi R | title = Effect of two orally active estradiol derivatives on sulfobromphthalein retention in rats | journal = Pharmacological Research Communications | volume = 6 | issue = 2 | pages = 135–145 | date = April 1974 | pmid = 4438394 | doi = 10.1016/s0031-6989(74)80021-4 }}{{cite book | vauthors = List PH, Hörhammer L | chapter = Orestratum |title=Chemikalien und Drogen Teil A: N-Q| chapter-url = https://books.google.com/books?id=4TWnBgAAQBAJ&pg=PA331 |date=12 March 2013|publisher=Springer-Verlag|isbn=978-3-642-65035-2|pages=331–}}{{cite book| vauthors = Roche EB, ((Academy of Pharmaceutical Sciences, ((Medicinal Chemistry Section)) |title=Design of biopharmaceutical properties through prodrugs and analogs: a symposium|url=https://books.google.com/books?id=T7zwAAAAMAAJ|year=1977|publisher=The Academy|isbn=978-0-917330-16-2|page=7}} It is the C3 propionate ester and C17β-(1-cyclohexenyl) ether of estradiol.