oryzalin
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 431581830
| IUPAC_name = 4-(Dipropylamino)-3,5-dinitrobenzenesulfonamide
| image = Oryzalin.svg
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 19044-88-3
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 662E385DWH
| ATC_prefix = none
| ATC_suffix =
| PubChem = 29393
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C18877
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 27326
| C=12 | H=18 | N=4 | O=6 | S=1
| smiles = CCCN(CCC)c1c([N+](=O)[O-])cc(S(N)(=O)=O)cc1[N+](=O)[O-]
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C12H18N4O6S/c1-3-5-14(6-4-2)12-10(15(17)18)7-9(23(13,21)22)8-11(12)16(19)20/h7-8H,3-6H2,1-2H3,(H2,13,21,22)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = UNAHYJYOSSSJHH-UHFFFAOYSA-N
| melting_point = 137
| melting_high = 139
}}
Oryzalin is a herbicide of the dinitroaniline class. It acts through the disruption (depolymerization) of microtubules, thus blocking anisotropic growth of plant cells.{{cite book | vauthors = Taiz L, Zeiger E |title=Plant Physiology | edition = 5th |date=2010 |publisher=Sinauer Associates |isbn=978-0-87893-866-7 |pages=433–434}} It can also be used to induce polyploidy in plants as an alternative to colchicine.{{cite journal | vauthors = Klíma M, Vyvadilová M, Kucera V | title = Chromosome doubling effects of selected antimitotic agents in Brassica napus microspore culture. | journal = Czech Journal of Genetics and Plant Breeding. | date = January 2008 | volume = 44 | issue = 1 | pages = 30–36 | doi = 10.17221/1328-CJGPB | url = http://www.agriculturejournals.cz/publicFiles/01063.pdf}}
References
{{Reflist}}
External links
- {{PPDB|494}}
{{Aniline Herbicides}}
{{Herbicides}}
Category:Dipropylamino compounds
Category:Nitrobenzene derivatives
Category:Preemergent herbicides
Category:Microtubule inhibitors
{{Pharmacology-stub}}