osmocene

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 428743038

| ImageFile = Osmocene_Eclipsed_Conformer_Structural_Formula.svg

| ImageSize = 100px

| ImageAlt =

| PIN = Osmocene{{cite book |author=International Union of Pure and Applied Chemistry |date=2014 |title=Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013 |publisher=The Royal Society of Chemistry |pages=1041 |doi=10.1039/9781849733069 |isbn=978-0-85404-182-4}}

| OtherNames = {{ubl|Di(cyclopentadienyl)osmium|Bis(η5-cyclopentadienyl)osmium}}

|Section1={{Chembox Identifiers

| CASNo =1273-81-0

| CASNo_Ref = {{cascite|correct|??}}

| PubChem = 6432038

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 71493

| SMILES = [cH-]1cccc1.[cH-]1cccc1.[Os+2]

| InChI = 1/2C5H5.Os/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1;+2

| InChIKey = RMYKEUKAFJLONI-UHFFFAOYAC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/2C5H5.Os/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1;+2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = RMYKEUKAFJLONI-UHFFFAOYSA-N }}

|Section2={{Chembox Properties

| C=10 | H=10 | Os=1

| Appearance = white solid

| Density =

| MeltingPt = 234 °C

| BoilingPt = 298 °C

| Solubility =

}}

|Section3={{Chembox Structure

| Structure_ref =

| CrystalStruct = orthorhombic

| PointGroup = D5h

| SpaceGroup = Pnma, No. 62

}}

|Section4={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

|Section5={{Chembox Related

| OtherCompounds = ferrocene, ruthenocene

}}

}}

Osmocene is an organoosmium compound found as a white solid. It is a metallocene with the formula Os(C5H5)2.

Synthesis

Osmocene is commercially available. It may be prepared by the reaction of osmium tetroxide with hydrobromic acid followed by zinc and cyclopentadiene.{{cite journal | last1 = Bobyens | first1 = J. C. A. | last2 = Levendis | first2 = D. C. | last3 = Bruce | first3 = Michael I. | last4 = Williams | first4 = Michael L. | title = Crystal structure of osmocene, Os(η-C5H5)2 | journal = Journal of Crystallographic and Spectroscopic Research | volume = 16 | pages = 519 | year = 1986 | doi = 10.1007/BF01161040 | issue = 4| s2cid = 96874978 }}

It was first synthesized by Ernst Otto Fischer and Heinrich Grumbert via the reaction of osmium(IV) chloride with excess sodium cyclopentadienide in dimethoxyethane, where osmium(II) chloride is presumed to be an intermediate formed in situ. Alternatively, cyclopentadienyl magnesium bromide could be reacted with osmium(IV) chloride, though this has worse yields.{{cite journal|last1=Fischer|first1=Ernst Otto|last2=Grumbert|first2=Heinrich|title=Über Aromatenkomplexe von Metallen, XXIX. Di-cyclopentadienyl-osmium|journal=Chem. Ber.|volume=92|issue=9|date=1959|pages=2302–2309|doi=10.1002/cber.19590920948}}

Properties

Osmocene is a white solid. The molecular structure features an osmium ion sandwiched between two cyclopentadienyl rings. It is isomorphous to the lighter homologue ruthenocene, both crystallizing in an eclipsed conformation. This is in contrast to ferrocene, which crystallizes with its rings staggered.

Compared to ferrocene and ruthenocene, osmocene is less reactive towards electrophilic aromatic substitution but has the greatest tendency towards adduct formation with Lewis acids.{{cite journal|last1=Kur|first1=Sally A.|last2=Rheingold|first2=Arnold L.|last3=Winter|first3=Charles H.|title=Synthesis, Characterization, and Halogenation of Decakis( acetoxymercurio)osmoene. Crystal and Molecular Structure of Decachloroosmocene|journal=Inorg. Chem.|date=1995 |volume=34|issue=1|pages=414–416|doi=10.1021/ic00105a067}}

The osmocenium cation [Os(C5H5)2]+ dimerizes, forming a binuclear complex with an Os-Os bond.{{cite journal|last1=Droege|first1=Michael W.|last2=Harman|first2=W. Dean|last3=Taube|first3=Henry|authorlink3=Henry Taube|title=Higher Oxidation State Chemistry of Osmocene: Dimeric Nature of the Osmocenium Ion|journal=Inorg. Chem.|date=1987 |volume=26|issue=8|pages=1309–1315|doi=10.1021/ic00255a023}} In contrast, the decamethylosmocenium cation [Os(C5(CH3)5)2]+ is stable as the monomer.{{cite book|last=Astruc|first=Didier|authorlink = Didier Astruc|title=Organometallic Chemistry and Catalysis|chapter=Metallocenes and Sandwich Complexes|page=263|publisher=Springer-Verlag|date=2007|isbn=978-3-540-46128-9|doi=10.1007/978-3-540-46129-6_13}}

Uses

In 2009, Horst Kunkely and Arnd Vogler reported the possibility of photocatalytic water splitting with osmocene as a catalyst.{{cite journal|last1=Kunkely|first1=Horst|last2=Vogler|first2=Arnd|title=Water Splitting by Light with Osmocene as Photocatalyst|journal=Angew. Chem. Int. Ed.|volume=48|issue=9|pages=1685–1687|date=2009|doi=10.1002/anie.200804712|pmid=19173275 |doi-access=free}}

References

{{Osmium compounds}}

{{Cyclopentadienide complexes}}

Category:Metallocenes

Category:Organoosmium compounds