oxametacin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 408354833

| IUPAC_name = 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]-N-hydroxyacetamide

| image = oxametacin.png

| image_class = skin-invert-image

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 27035-30-9

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 31057

| ATC_prefix = M01

| ATC_suffix = AB13

| PubChem = 33675

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8G02RSW5CM

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07266

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 76255

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 295829

| C=19 | H=17 | Cl=1 | N=2 | O=4

| smiles = CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)NO

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C19H17ClN2O4/c1-11-15(10-18(23)21-25)16-9-14(26-2)7-8-17(16)22(11)19(24)12-3-5-13(20)6-4-12/h3-9,25H,10H2,1-2H3,(H,21,23)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = AJRNYCDWNITGHF-UHFFFAOYSA-N

}}

Oxametacin (or oxamethacin) is a non-steroidal anti-inflammatory drug.{{cite book | vauthors = Schweiger J | chapter = Oxametacin | pages = 367–368 | veditors = von Bruchhausen F, Ebel S, Hackenthal E, Holzgrabe U |title=Hagers Handbuch der Pharmazeutischen Praxis: Stoffe L-Z Folgeband 5 |date=1999 |location=Berlin, Heidelberg |isbn=978-3-642-58388-9 |edition= 5th, vollständig neubearbeitete Auflage | language = German | chapter-url = https://books.google.com/books?id=vWIiBgAAQBAJ&dq=Oxametacin&pg=PA368}}

Hydrolysis of the amide group is one of the synthetic pathways to Deboxamet ([https://www.chemdrug.com/article/8/3284/16419291.html ChemDrug]).