oxathiapiprolin

{{Chembox

| ImageFile = Oxathiapiprolin skeletal.svg

| ImageSize = 200px

| ImageAlt =

| PIN = 1²,1⁶-Difluoro-7⁵-methyl-7³-(trifluoromethyl)-2⁴,2⁵-dihydro-4(4,1)-piperidina-2(5,3)-[1,2]oxazola-3(4,2)-[1,3]thiazola-7(1)-pyrazola-1(1)-benzenaheptaphan-5-one

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 1003318-67-9

| CASNo_Ref = {{cascite|correct|CAS}}

| Beilstein = 20731698

| ChEBI = 83271

| ChemSpiderID = 32697748

| EINECS = 801-263-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 56498AIV8R

| PubChem = 56945145

| SMILES = CC1=CC(=NN1CC(=O)N2CCC(CC2)C3=NC(=CS3)C4=NOC(C4)C5=C(C=CC=C5F)F)C(F)(F)F

| InChI=1S/C24H22F5N5O2S/c1-13-9-20(24(27,28)29)31-34(13)11-21(35)33-7-5-14(6-8-33)23-30-18(12-37-23)17-10-19(36-32-17)22-15(25)3-2-4-16(22)26/h2-4,9,12,14,19H,5-8,10-11H2,1H3

| InChIKey =IAQLCKZJGNTRDO-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=24|H=22|F=5|N=5|O=2|S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Oxathiapiprolin (trade names Orondis, Zorvec, and Segovis) is a fungicide. In the United States, the Environmental Protection Agency has approved it for use against several fungal diseases including downy mildew and various Phytophthora species including late blight on crops including vegetables, ornamentals, and turf.{{cite web | url = http://www.mda.state.mn.us/chemicals/pesticides/regs/~/media/Files/chemicals/reviews/nair-oxathiapiprolin.pdf | title = Oxathiapiprolin | work = New Active Ingredient Review | date = October 2015 | publisher = Minnesota Department of Agriculture | access-date = 2017-11-03 | archive-url = https://web.archive.org/web/20171107025015/http://www.mda.state.mn.us/chemicals/pesticides/regs/~/media/Files/chemicals/reviews/nair-oxathiapiprolin.pdf | archive-date = 2017-11-07 | url-status = dead }}

Its mechanism of action involves binding to the oxysterol-binding protein in Oomycetes.{{cite journal | doi = 10.1371/journal.pone.0140015

| pmid = 26452052

| pmc = 4599937

| title = The Novel Oomycide Oxathiapiprolin Inhibits All Stages in the Asexual Life Cycle of Pseudoperonospora cubensis - Causal Agent of Cucurbit Downy Mildew

| journal = PLOS ONE

| volume = 10

| issue = 10

| pages = e0140015

| year = 2015

| last1 = Cohen

| first1 = Yigal

| bibcode = 2015PLoSO..1040015C

| doi-access = free

}}{{cite book | doi = 10.1021/bk-2015-1204.ch011| chapter = The Discovery of Oxathiapiprolin: A New, Highly-Active Oomycete Fungicide with a Novel Site of Action| title = Discovery and Synthesis of Crop Protection Products| volume = 1204| pages = 149| series = ACS Symposium Series| year = 2015| last1 = Pasteris| first1 = Robert J| last2 = Hanagan| first2 = Mary Ann| last3 = Bisaha| first3 = John J| last4 = Finkelstein| first4 = Bruce L| last5 = Hoffman| first5 = Lisa E| last6 = Gregory| first6 = Vann| last7 = Shepherd| first7 = Christopher P| last8 = Andreassi| first8 = John L| last9 = Sweigard| first9 = James A| last10 = Klyashchitsky| first10 = Boris A| last11 = Henry| first11 = Yewande T| last12 = Berger| first12 = Richard A| isbn = 978-0-8412-3102-3}}