oxogestone
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = (8R,9S,10R,13S,14S,17S)-17-[(1R)-1-hydroxyethyl]-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one
| image = Oxogestone.svg
| width = 225px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 3643-00-3
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| PubChem = 19275
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 18186
| UNII = A98264FU0C
| synonyms = Oxagestone; Oxagesterone; Oxogesterone; 20β-Hydroxy-19-norprogesterone; (20R)-20-Hydroxy-19-norpregn-4-en-3-one
| C=20 | H=30 | O=2
| SMILES = CC(C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34)C)O
| StdInChI_Ref =
| StdInChI = 1S/C20H30O2/c1-12(21)18-7-8-19-17-5-3-13-11-14(22)4-6-15(13)16(17)9-10-20(18,19)2/h11-12,15-19,21H,3-10H2,1-2H3/t12-,15+,16-,17-,18-,19+,20-/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = CNOGNHFPIBORED-JIKCGYBYSA-N
}}
Oxogestone ({{abbrlink|INN|International Nonproprietary Name}}), also known as 20β-hydroxy-19-norprogesterone, is a progestin of the 19-norprogesterone group which was synthesized in 1953 and was developed as an injectable hormonal contraceptive in the early 1970s but was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA919|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=919–}}{{cite book| vauthors = Milne GW |title=Drugs: Synonyms and Properties: Synonyms and Properties|url=https://books.google.com/books?id=xUlaDwAAQBAJ&pg=PT1577|date=8 May 2018|publisher=Taylor & Francis|isbn=978-1-351-78989-9|pages=1577–}}{{cite journal | vauthors = Farkas M, Szontágh FE | title = Clinical experiences concerning the intramuscular contraceptive oxogestone | journal = Acta Europaea Fertilitatis | volume = 3 | issue = 1 | pages = 37–43 | date = March 1972 | pmid = 4679651 | url = http://www.popline.org/node/489650 }}{{cite journal | vauthors = Ruíz Velasco V, Alisedo Aparicio LE | title = [Side effects of depot contraceptives] | language = es | journal = La Prensa Medica Mexicana | volume = 37 | issue = 1 | pages = 25–29 | year = 1972 | pmid = 5032612 | url = http://www.popline.org/node/489759 }}{{cite journal | vauthors = Bassol S, Garza-Flores J | title = Review of ovulation return upon discontinuation of once-a-month injectable contraceptives | journal = Contraception | volume = 49 | issue = 5 | pages = 441–453 | date = May 1994 | pmid = 8045131 | doi = 10.1016/0010-7824(94)90003-5 }} A C20β phenylpropionate derivative, oxogestone phenpropionate, also exists.
References
{{Reflist}}
{{Progesterone receptor modulators}}
Category:Hormonal contraception
{{Genito-urinary-drug-stub}}
{{Steroid-stub}}