oxolamine

{{Short description|Cough suppressant}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 447812881

| IUPAC_name = N,N-diethyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine

| image = Oxolamine.png

| tradename =

| Drugs.com = {{drugs.com|international|oxolamine}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 959-14-8

| ATC_prefix = R05

| ATC_suffix = DB07

| PubChem = 13738

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB13216

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 13143

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 90BEA145GY

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07387

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1620875

| C=14 | H=19 | N=3 | O=1

| smiles = n1c(onc1c2ccccc2)CCN(CC)CC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H19N3O/c1-3-17(4-2)11-10-13-15-14(16-18-13)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = IDCHQQSVJAAUQQ-UHFFFAOYSA-N

}}

Oxolamine is a cough suppressant{{cite book | vauthors = de Groot AC | chapter = 3.357 Oxolamine |title=Systemic Drugs | series = Monographs in Contact Allergy | volume = 4 |date=2022 |publisher=CRC Press |isbn=978-1-00-054991-1 |page=712 |edition=First}} that is available as a generic drug in many jurisdictions.{{cite web | work = drugs.com | url = https://www.drugs.com/international/oxolamine.html | title = Oxolamine | date = 19 April 2015 | access-date = 23 January 2018 | archive-date = 20 September 2018 | archive-url = https://web.archive.org/web/20180920145016/https://www.drugs.com/international/oxolamine.html | url-status = live }}

Oxolamine also has anti-inflammatory activity, which causes a reduction in irritation of the nerve receptors of the respiratory tract.{{Cite web |title=NCATS Inxight Drugs — OXOLAMINE CITRATE |url=https://drugs.ncats.io/drug/K5X4XBR694 |access-date=2022-09-26 |website=drugs.ncats.io |language=en |archive-date=2022-09-26 |archive-url=https://web.archive.org/web/20220926180401/https://drugs.ncats.io/drug/K5X4XBR694 |url-status=live }}

It is mainly used for the treatment of pharyngitis, tracheitis, bronchitis, bronchiectasis and pertussis.

Oxolamine is not approved in the USA, it may be marketed elsewhere internationally as a cough suppressant. It is listed as a prescription drug in New Zealand legislation. Oxolamine is also approved in Taiwan for the treatment of respiratory tract inflammation.{{Cite web |title=Oxolamine |url=https://go.drugbank.com/drugs/DB13216 |access-date=2022-09-26 |website=go.drugbank.com |archive-date=2022-09-26 |archive-url=https://web.archive.org/web/20220926180403/https://go.drugbank.com/drugs/DB13216 |url-status=live }}