oxomemazine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447980724

| IUPAC_name = 3-(5,5-Dioxido-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine

| image = oxomemazine.svg

| width = 150

| tradename =

| Drugs.com = {{drugs.com|international|oxomemazine}}

| pregnancy_category =

| legal_US = Not approved

| legal_status = Rx-only

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 3689-50-7

| ATC_prefix = R06

| ATC_suffix = AD08

| PubChem = 19396

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 18281

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2104734

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 305MB38V1C

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07401

| C=18 | H=22 | N=2 | O=2 | S=1

| smiles = O=S3(=O)c1ccccc1N(c2c3cccc2)CC(C)CN(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H22N2O2S/c1-14(12-19(2)3)13-20-15-8-4-6-10-17(15)23(21,22)18-11-7-5-9-16(18)20/h4-11,14H,12-13H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = QTQPVLDZQVPLGV-UHFFFAOYSA-N

}}

Oxomemazine is an antihistamine and anticholinergic of the phenothiazine chemical class for the treatment of cough.{{cite journal | vauthors = Pujet JC, Keddad K, Sévenier F, Jolivet-Landreau I | title = [Comparative study of two antitussive drugs in the treatment of acute dry cough of infectious origin (prospective, randomized, single blind study)] | journal = Therapie | volume = 57 | issue = 5 | pages = 457–63 | year = 2002 | pmid = 12611200 }}{{cite journal | vauthors = Lee SW, Woo CW, Kim JG | title = Selectivity of oxomemazine for the M1 muscarinic receptors | journal = Archives of Pharmacal Research | volume = 17 | issue = 6 | pages = 443–51 | date = December 1994 | pmid = 10319156 | doi = 10.1007/BF02979123 | s2cid = 34007107 }}