oxycinchophen

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447986875

| IUPAC_name = 3-Hydroxy-2-phenyl-4-quinolinecarboxylic acid

| image = Oxycinchophen.svg

| width = 175

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 485-89-2

| ATC_prefix = M01

| ATC_suffix = CA03

| PubChem = 10239

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UK6392GD5W

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07271

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 9822

| smiles = O=C(O)c1c3ccccc3nc(c1O)c2ccccc2

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H11NO3/c18-15-13(16(19)20)11-8-4-5-9-12(11)17-14(15)10-6-2-1-3-7-10/h1-9,18H,(H,19,20)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = XAPRFLSJBSXESP-UHFFFAOYSA-N

| C=16 | H=11 | N=1 | O=3

}}

Oxycinchophen is an antirheumatic agent.{{cite journal | vauthors = Iversen M, Munck J, Schourup K | title = On the toxicity of 3-hydroxy-2-phenylcinchoninic acid (oxycinchophen); histo-pathological studies in rabbits and guinea-pigs | journal = Acta Pharmacologica et Toxicologica | volume = 9 | issue = 3 | pages = 215–9 | year = 1953 | pmid = 13123940 | doi = 10.1111/j.1600-0773.1953.tb02948.x }}{{cite patent | country = US | number = 2776290 | gdate = 1957 | assign1 = Chemo Puro }}