pacritinib
{{Short description|Medication used to treat myelofibrosis}}
{{Use American English|date=March 2022}}
{{Use dmy dates|date=March 2022}}
{{Infobox drug
| type =
| image = Pacritinib skeletal.svg
| width = 230
| alt =
| caption =
| pronounce =
| tradename = Vonjo
| Drugs.com =
| MedlinePlus =
| DailyMedID = Pacritinib
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category=
| routes_of_administration = By mouth
| class =
| ATC_prefix = L01
| ATC_suffix = EJ03
| ATC_supplemental =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment = {{cite web | title=Vonjo- pacritinib capsule | website=DailyMed | date=7 March 2022 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=4b5ab444-0e1a-4984-99db-76ad11a298ee | access-date=24 March 2022}}
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number = 937272-79-2
| CAS_supplemental =
| PubChem = 46216796
| IUPHAR_ligand =
| DrugBank = DB11697
| ChemSpiderID = 28518965
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = G22N65IL3O
| KEGG = D11768
| ChEBI = 231350 =
| ChEMBL = 2035187
| NIAID_ChemDB =
| PDB_ligand = 6T3
| synonyms = SB1518
| IUPAC_name = (16E)-11-[2-(1-Pyrrolidinyl)ethoxy]-14,19-dioxa-5,7,26-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(26),3,5,8,10,12(27),16,21,23-decaene
| C=28 | H=32 | N=4 | O=3
| SMILES = c1cc2cc(c1)-c3ccnc(n3)Nc4ccc(c(c4)COC/C=C/COC2)OCCN5CCCC5
| StdInChI=1S/C28H32N4O3/c1-2-13-32(12-1)14-17-35-27-9-8-25-19-24(27)21-34-16-4-3-15-33-20-22-6-5-7-23(18-22)26-10-11-29-28(30-25)31-26/h3-11,18-19H,1-2,12-17,20-21H2,(H,29,30,31)/b4-3+
| StdInChI_comment =
| StdInChIKey = HWXVIOGONBBTBY-ONEGZZNKSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
Pacritinib, sold under the brand name Vonjo, is an anti-cancer medication used to treat myelofibrosis. It is a macrocyclic protein kinase inhibitor. It mainly inhibits Janus kinase 2 (JAK2) and Fms-like tyrosine kinase 3\CD135 (FLT3).
Common side effects include diarrhea, low platelet counts, nausea, anemia, and swelling in legs.
Medical uses
Pacritinib in indicated to treat adults who have a rare form of a bone marrow disorder known as intermediate or high-risk primary or secondary myelofibrosis and who have platelet (blood clotting cells) levels below 50,000/μL.{{cite web | title=FDA approves drug for adults with rare form of bone marrow disorder | website=U.S. Food and Drug Administration | date=1 March 2022 | url=https://www.fda.gov/drugs/news-events-human-drugs/fda-approves-drug-adults-rare-form-bone-marrow-disorder | archive-url=https://web.archive.org/web/20220301202358/https://www.fda.gov/drugs/news-events-human-drugs/fda-approves-drug-adults-rare-form-bone-marrow-disorder | url-status=dead | archive-date=1 March 2022 | access-date=3 March 2022}} {{PD-notice}}
History
The effectiveness and safety of pacritinib were demonstrated in a study that included 63 participants with intermediate or high-risk primary or secondary myelofibrosis and low platelets who received pacritinib 200{{nbsp}}mg twice daily or standard treatment. Effectiveness was determined based upon the proportion of participants who had a 35% or greater spleen volume reduction from baseline to week 24. Nine participants (29%) in the pacritinib treatment group had a 35% or greater spleen volume reduction, compared to one participant (3%) in the standard treatment group.
The U.S. Food and Drug Administration (FDA) granted the application for pacritinib priority review, fast track, and orphan drug designations.
Society and culture
= Names =
Pacritinib is the International nonproprietary name (INN).{{cite journal | vauthors = ((World Health Organization)) | title = International nonproprietary names for pharmaceutical substances (INN). proposed INN: list 104 | journal = WHO Drug Information | volume = 24 | issue = 4 | year = 2010 | url = https://www.who.int/medicines/publications/druginformation/innlists/PL104.pdf | author-link = World Health Organization | hdl=10665/74579 | hdl-access=free | page=386 }}{{cite journal | vauthors=((World Health Organization)) | year=2011 | title=International nonproprietary names for pharmaceutical substances (INN): recommended INN: list 66 | journal=WHO Drug Information | volume=25 | issue=3 | page= | hdl=10665/74683 | hdl-access=free | author-link=World Health Organization }}
References
{{Reflist}}
External links
- {{cite web | url = https://druginfo.nlm.nih.gov/drugportal/name/pacritinib | publisher = U.S. National Library of Medicine | work = Drug Information Portal | title = Pacritinib }}
{{Extracellular chemotherapeutic agents}}
{{Cytokine receptor modulators}}
{{Portal bar | Medicine}}
Category:Non-receptor tyrosine kinase inhibitors
Category:1-Pyrrolidinyl compounds
Category:Nitrogen heterocycles
{{antineoplastic-drug-stub}}