pamapimod

{{Short description|Investigational drug}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Pamapimod.svg

| width =

| alt =

| caption =

| image2 =

| width2 =

| alt2 =

| caption2 =

| imageL =

| widthL =

| altL =

| imageR =

| widthR =

| altR =

| captionLR =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 449811-01-2

| CAS_supplemental =

| PubChem = 16220188

| PubChemSubstance =

| IUPHAR_ligand = 9915

| DrugBank =

| ChemSpiderID = 17347490

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8S2C9V11K4

| KEGG = D08963

| ChEBI = 90685

| ChEMBL = 1090089

| NIAID_ChemDB =

| PDB_ligand = FLW

| synonyms =

| IUPAC_name = 6-(2,4-difluorophenoxy)-2-(1,5-dihydroxypentan-3-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one

| chemical_formula = |C=19 |H=20 |F=2 |N=4 |O=4

| molecular_weight =

| SMILES = CN1C2=NC(=NC=C2C=C(C1=O)OC3=C(C=C(C=C3)F)F)NC(CCO)CCO

| Jmol =

| StdInChI = InChI=1S/C19H20F2N4O4/c1-25-17-11(10-22-19(24-17)23-13(4-6-26)5-7-27)8-16(18(25)28)29-15-3-2-12(20)9-14(15)21/h2-3,8-10,13,26-27H,4-7H2,1H3,(H,22,23,24)

| StdInChI_comment =

| StdInChIKey = JYYLVUFNAHSSFE-UHFFFAOYSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Pamapimod is an investigational drug which is being evaluated for the treatment of autoimmune diseases. It is a p38 mitogen-activated protein kinase inhibitor.{{cite journal | vauthors = Hill RJ, Dabbagh K, Phippard D, Li C, Suttmann RT, Welch M, Papp E, Song KW, Chang KC, Leaffer D, Kim YN, Roberts RT, Zabka TS, Aud D, Dal Porto J, Manning AM, Peng SL, Goldstein DM, Wong BR | title = Pamapimod, a novel p38 mitogen-activated protein kinase inhibitor: preclinical analysis of efficacy and selectivity | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 327 | issue = 3 | pages = 610–9 | date = December 2008 | pmid = 18776065 | doi = 10.1124/jpet.108.139006 }} It has been evaluated in a phase 2 clinical trial for the treatment of rheumatoid arthritis, but was found not to be effective.{{cite journal | vauthors = Cohen S, Fleischmann R | title = Kinase inhibitors: a new approach to rheumatoid arthritis treatment | journal = Current Opinion in Rheumatology | volume = 22 | issue = 3 | pages = 330–5 | date = May 2010 | pmid = 20164774 | doi = 10.1097/BOR.0b013e3283378e6f }}{{cite journal | vauthors = Cohen SB, Cheng TT, Chindalore V, Damjanov N, Burgos-Vargas R, Delora P, Zimany K, Travers H, Caulfield JP | title = Evaluation of the efficacy and safety of pamapimod, a p38 MAP kinase inhibitor, in a double-blind, methotrexate-controlled study of patients with active rheumatoid arthritis | journal = Arthritis and Rheumatism | volume = 60 | issue = 2 | pages = 335–344 | date = February 2009 | pmid = 19180516 | doi = 10.1002/art.24266 }} It has subsequently been investigated as a possible treatment for osteoarthritis.{{cite journal | vauthors = Zhao X, Ning L, Xie Z, Jie Z, Li X, Wan X, Sun X, Huang B, Tang P, Shen S, Qin A, Ma Y, Song L, Fan S, Wan S | title = The Novel p38 Inhibitor, Pamapimod, Inhibits Osteoclastogenesis and Counteracts Estrogen-Dependent Bone Loss in Mice | journal = Journal of Bone and Mineral Research | volume = 34 | issue = 5 | pages = 911–922 | date = May 2019 | pmid = 30615802 | doi = 10.1002/jbmr.3655 }}{{cite journal | vauthors = Zhang J, Yan C, He W, Wang M, Liu J | title = Inhibition against p38/MEF2C pathway by Pamapimod protects osteoarthritis chondrocytes hypertrophy | journal = Panminerva Medica | date = December 2020 | volume = 66 | issue = 4 | pages = 365–371 | pmid = 33263251 | doi = 10.23736/S0031-0808.20.04170-1 }}

See also

References