panipenem

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 397252594

| IUPAC_name = (5R,6S)-3-{[(3S)-1-ethanimidoylpyrrolidin-3-yl]sulfanyl}- 6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene- 2-carboxylic acid

| image = Panipenem.svg

| tradename =

| Drugs.com = {{drugs.com|international|panipenem}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 87726-17-8

| ATC_prefix = J01

| ATC_suffix = DH55

| ATC_supplemental = (with betamipron)

| PubChem = 72015

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = W9769W09JF

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 339323

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 16736434

| KEGG = D01048

| chemical_formula =

| C=15 | H=21 | N=3 | O=4 | S=1

| smiles = C[C@H]([C@@H]1[C@H]2CC(=C(N2C1=O)C(=O)O)S[C@H]3CCN(C3)C(=N)C)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C15H21N3O4S/c1-7(19)12-10-5-11(13(15(21)22)18(10)14(12)20)23-9-3-4-17(6-9)8(2)16/h7,9-10,12,16,19H,3-6H2,1-2H3,(H,21,22)/t7-,9+,10-,12-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = TYMABNNERDVXID-DLYFRVTGSA-N

}}

Panipenem (INN) is a carbapenem antibiotic used in combination with betamipron.{{cite journal | vauthors = Goa KL, Noble S | title = Panipenem/betamipron | journal = Drugs | volume = 63 | issue = 9 | pages = 913–25; discussion 926 | year = 2003 | pmid = 12678575 | doi = 10.2165/00003495-200363090-00005 | s2cid = 263994230 | url = https://www.researchgate.net/publication/10818753 }} It is not used in the United States.{{cn|date=March 2023}}