para-Azoxyanisole

{{DISPLAYTITLE:para-Azoxyanisole}}

{{chembox

| Watchedfields = changed

| verifiedrevid = 456075721

| Name = para-Azoxyanisole

| ImageFile = Para-azoxyanisole.svg

| ImageSize = 200px

| ImageName = Para-Azoxyanisole

| IUPACName = 1-Methoxy-4-[(4-methoxyphenyl)-NNO-azoxy]benzene

| OtherNames =p-Azoxyanisole

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 1562-94-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4G08S4XUIX

| SMILES = COc2ccc(\N=[N+](/[O-])c1ccc(OC)cc1)cc2

| PubChem = 15277

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 14542

| InChI = 1/C14H14N2O3/c1-18-13-7-3-11(4-8-13)15-16(17)12-5-9-14(19-2)10-6-12/h3-10H,1-2H3/b16-15-

| InChIKey = KAEZRSFWWCTVNP-NXVVXOECBU

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H14N2O3/c1-18-13-7-3-11(4-8-13)15-16(17)12-5-9-14(19-2)10-6-12/h3-10H,1-2H3/b16-15-

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KAEZRSFWWCTVNP-NXVVXOECSA-N

}}

|Section2={{Chembox Properties

| C=14 | H= 14 | N=2 | O=3

| Appearance =

| Density = 1.14 g/cm³

| MeltingPtC = 114.9

| BoilingPtC = 417.9

| BoilingPt_notes = at 760 mmHg{{dubious|reason=418 °C is way too high to be real - it will surely decompose well below this temperature|date=September 2021}}{{cn|date=September 2021}}

}}

|Section3={{Chembox Hazards

| FlashPtC = 206.6

}}

}}

para-Azoxyanisole (PAA) is an organic, aromatic compound. Its chemical formula is C₁₄H₁₄N₂O₃. In a solid state, it appears as a white powder, but when heated it forms a liquid crystal. As one of the first known and most readily prepared liquid crystals,{{cite journal|title=Phase Transitions of Liquid Crystal PAA in Confined Geometries|author1=Shao, Y. |author2=Zerda, T. W. |journal=Journal of Physical Chemistry B|year=1998|volume=102|issue=18|pages=3387–3394|doi=10.1021/jp9734437}} PAA has played an important role in the development of liquid crystal displays.Liquid Gold: The Story of Liquid Crystal Displays and the Creation of an Industry, Joseph A. Castellano, {{ISBN|978-981-238-956-5}}

Its liquid crystal range is from 118 °C to 136 °C. The solid to nematic transition is at 118 °C and the nematic to isotropic liquid transition at 136 °C.