paramethasone

{{Short description|Chemical compound}}

{{Distinguish|Paramethadione}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 429748383

| IUPAC_name = (6α,11β,16α)-6-fluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione

| image = Paramethasone.svg

| tradename =

| Drugs.com = {{drugs.com|international|paramethasone}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 53-33-8

| ATC_prefix = H02

| ATC_suffix = AB05

| PubChem = 5875

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB01384

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5664

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = VFC6ZX3584

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1579

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C07413

| C=22 | H=29 | F=1 | O=5

| smiles = O=C\1\C=C/[C@]4(/C(=C/1)[C@@H](F)C[C@@H]2[C@@H]4[C@@H](O)C[C@@]3([C@@](O)(C(=O)CO)[C@@H](C[C@@H]23)C)C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H29FO5/c1-11-6-14-13-8-16(23)15-7-12(25)4-5-20(15,2)19(13)17(26)9-21(14,3)22(11,28)18(27)10-24/h4-5,7,11,13-14,16-17,19,24,26,28H,6,8-10H2,1-3H3/t11-,13+,14+,16+,17+,19-,20+,21+,22+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = MKPDWECBUAZOHP-AFYJWTTESA-N

| synonyms = (6S,8S,9S,10R,11S,13S,14S,16R,17R)-6-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one

}}

Paramethasone is a fluorinated glucocorticoid with anti-inflammatory and immunosuppressant properties.Toxnet: [http://toxnet.nlm.nih.gov/cgi-bin/sis/search2/f?./temp/~jn3CBx:1 Paramethasone] {{Webarchive|url=https://web.archive.org/web/20190829101551/https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/f%3f./temp/~jn3CBx:1 |date=2019-08-29 }}

References

{{Reflist|2}}

Further reading

{{refbegin}}

  • {{cite journal | vauthors = Wershil BK, Furuta GT, Lavigne JA, Choudhury AR, Wang ZS, Galli SJ | title = Dexamethasone and cyclosporin A suppress mast cell-leukocyte cytokine cascades by multiple mechanisms | journal = International Archives of Allergy and Immunology | volume = 107 | issue = 1–3 | pages = 323–4 | year = 1995 | pmid = 7613160 | doi = 10.1159/000237015 | doi-access = free }}
  • {{cite journal | vauthors = Riccardi C, Cifone MG, Migliorati G | title = Glucocorticoid hormone-induced modulation of gene expression and regulation of T-cell death: role of GITR and GILZ, two dexamethasone-induced genes | journal = Cell Death and Differentiation | volume = 6 | issue = 12 | pages = 1182–9 | date = December 1999 | pmid = 10637434 | doi = 10.1038/sj.cdd.4400609 | doi-access = free }}
  • {{cite journal | vauthors = Lavista Llanos S, Roldán A | title = Effect of dexamethasone on nitric oxide (NO.) production by cultured astrocytes | journal = Biocell | volume = 23 | issue = 1 | pages = 29–35 | date = April 1999 | pmid = 10904533 }}

{{refend}}

{{Glucocorticoids}}

{{Glucocorticoidics}}

Category:Glucocorticoids

Category:Organofluorides

{{systemic-hormonal-drug-stub}}