paramethasone
{{Short description|Chemical compound}}
{{Distinguish|Paramethadione}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 429748383
| IUPAC_name = (6α,11β,16α)-6-fluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione
| image = Paramethasone.svg
| tradename =
| Drugs.com = {{drugs.com|international|paramethasone}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 53-33-8
| ATC_prefix = H02
| ATC_suffix = AB05
| PubChem = 5875
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB01384
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5664
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = VFC6ZX3584
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1579
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C07413
| C=22 | H=29 | F=1 | O=5
| smiles = O=C\1\C=C/[C@]4(/C(=C/1)[C@@H](F)C[C@@H]2[C@@H]4[C@@H](O)C[C@@]3([C@@](O)(C(=O)CO)[C@@H](C[C@@H]23)C)C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H29FO5/c1-11-6-14-13-8-16(23)15-7-12(25)4-5-20(15,2)19(13)17(26)9-21(14,3)22(11,28)18(27)10-24/h4-5,7,11,13-14,16-17,19,24,26,28H,6,8-10H2,1-3H3/t11-,13+,14+,16+,17+,19-,20+,21+,22+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MKPDWECBUAZOHP-AFYJWTTESA-N
| synonyms = (6S,8S,9S,10R,11S,13S,14S,16R,17R)-6-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one
}}
Paramethasone is a fluorinated glucocorticoid with anti-inflammatory and immunosuppressant properties.Toxnet: [http://toxnet.nlm.nih.gov/cgi-bin/sis/search2/f?./temp/~jn3CBx:1 Paramethasone] {{Webarchive|url=https://web.archive.org/web/20190829101551/https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/f%3f./temp/~jn3CBx:1 |date=2019-08-29 }}
References
{{Reflist|2}}
Further reading
{{refbegin}}
- {{cite journal | vauthors = Wershil BK, Furuta GT, Lavigne JA, Choudhury AR, Wang ZS, Galli SJ | title = Dexamethasone and cyclosporin A suppress mast cell-leukocyte cytokine cascades by multiple mechanisms | journal = International Archives of Allergy and Immunology | volume = 107 | issue = 1–3 | pages = 323–4 | year = 1995 | pmid = 7613160 | doi = 10.1159/000237015 | doi-access = free }}
- {{cite journal | vauthors = Riccardi C, Cifone MG, Migliorati G | title = Glucocorticoid hormone-induced modulation of gene expression and regulation of T-cell death: role of GITR and GILZ, two dexamethasone-induced genes | journal = Cell Death and Differentiation | volume = 6 | issue = 12 | pages = 1182–9 | date = December 1999 | pmid = 10637434 | doi = 10.1038/sj.cdd.4400609 | doi-access = free }}
- {{cite journal | vauthors = Lavista Llanos S, Roldán A | title = Effect of dexamethasone on nitric oxide (NO.) production by cultured astrocytes | journal = Biocell | volume = 23 | issue = 1 | pages = 29–35 | date = April 1999 | pmid = 10904533 }}
{{refend}}
{{Glucocorticoids}}
{{Glucocorticoidics}}
{{systemic-hormonal-drug-stub}}