paraxazone

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-(3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl)acetamide

| image = Paraxazone.png

| image_class = skin-invert-image

| tradename =

| pregnancy_category = ?

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 26513-79-1

| ATC_prefix = none

| ATC_suffix =

| PubChem = 3047812

| ChemSpiderID = 2310126

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2H6ON8WA7L

| C=10 | H=10 | N=2 | O=3

| smiles = O=C(N)CN1c2c(OCC1=O)cccc2

}}

Paraxazone is an antidepressant.{{cite book | vauthors = Triggle DJ | title = Dictionary of Pharmacological Agents | publisher = Chapman & Hall/CRC | location = Boca Raton | year = 1996 | isbn = 0-412-46630-9 }} It acts as a reversible inhibitor of the enzyme monoamine oxidase (MAO).{{Citation needed|date=April 2010}} It was never marketed.