peforelin
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = (3S)-4-
| image = Peforelin.svg
| width = 250px
| tradename = Maprelin
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = Injection
| class = GnRH agonist
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 147859-97-0
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 16197823
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 17326238
| UNII = UJ8NQ5Z0VX
| KEGG =
| ChEBI =
| ChEMBL =
| synonyms = Lamprey GnRH-III; H-Pyr-His-Trp-Ser-His-Asp-Trp-Lys-Pro-Gly-NH{{Sub|2}}; XHWSHDWKPG
| C=59 | H=74 | N=18 | O=14
| SMILES = NCCCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H]1CCC(=O)N1)C(=O)N1CCC[C@H]1C(=O)NCC(N)=O
| StdInChI_Ref =
| StdInChI = 1S/C59H74N18O14/c60-16-6-5-12-40(59(91)77-17-7-13-47(77)58(90)66-27-48(61)79)70-52(84)41(18-31-23-64-37-10-3-1-8-35(31)37)72-56(88)45(22-50(81)82)75-55(87)44(21-34-26-63-30-68-34)74-57(89)46(28-78)76-53(85)42(19-32-24-65-38-11-4-2-9-36(32)38)71-54(86)43(20-33-25-62-29-67-33)73-51(83)39-14-15-49(80)69-39/h1-4,8-11,23-26,29-30,39-47,64-65,78H,5-7,12-22,27-28,60H2,(H2,61,79)(H,62,67)(H,63,68)(H,66,90)(H,69,80)(H,70,84)(H,71,86)(H,72,88)(H,73,83)(H,74,89)(H,75,87)(H,76,85)(H,81,82)/t39-,40-,41-,42-,43-,44-,45-,46-,47-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = RTASYRSYWSLWJV-CSYZDTNESA-N
}}
Peforelin ({{abbrlink|INN|International Nonproprietary Name}}), or peforelin acetate, sold under the brand name Maprelin, is a gonadotropin-releasing hormone agonist (GnRH agonist) medication which is used in veterinary medicine in Europe and Canada.{{Cite web| url=https://www.drugs.com/international/peforelin.html | title=Peforelin | access-date=2018-07-28 | archive-date=2019-08-29 | archive-url=https://web.archive.org/web/20190829140040/https://www.drugs.com/international/peforelin.html | url-status=dead}}{{cite web|url=https://www.drugs.com/vet/maprelin-xp-10-can.html|title = Maprelin XP-10 (Canada) for Animal Use}}{{cite book| vauthors = Löscher W, Richter A, Potschka H |title=Pharmakotherapie bei Haus- und Nutztieren: Begründet von W. Löscher, F.R. Ungemach und R. Kroker|url=https://books.google.com/books?id=g1ldBAAAQBAJ&pg=PA435|date=3 September 2014|publisher=Enke|isbn=978-3-8304-1251-9|pages=435–}}{{cite book| vauthors = Rodriguez-Martinez H |title=Control of Pig Reproduction VIII|url=https://books.google.com/books?id=em-TrWgAFSYC&pg=PA190|date=1 April 2010|publisher=Nottingham University Press|isbn=978-1-907284-53-3|pages=190–}} It is a GnRH analogue and a synthetic peptide, specifically a decapeptide. The drug was introduced for veterinary use by 2001.{{Cite web | url=http://www.sgau.ru/files/pages/846/14713368000.pdf#page=48 | title=Species composition and population dynamics of leafhoppers in agrocenosis of spring wheat in the saratov right bank region | website=www.sgau.ru}}
See also
References
{{Reflist}}
{{GnRH and gonadotropins}}
{{GnRH and gonadotropin receptor modulators}}
{{Drug-stub}}