penicillic acid

{{chembox

| Watchedfields = changed

| verifiedrevid = 433999950

| ImageFile = Penicillic acid.svg

| ImageSize = 300px

| ImageAlt = Skeletal formulas of two tautomers

| ImageFile1 = Penicillic-acid-3D-balls.png

| ImageSize1 = 200

| ImageAlt1 = Ball-and-stick model

| IUPACName=5-Hydroxy-5-isopropenyl-4-methoxy-furan-2-one

| OtherNames=

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=90-65-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ONL14K3AFD

| PubChem=1268111

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C19495

| SMILES=CC(=C)C1(C=CC(=O)O1)O

}}

|Section2={{Chembox Properties

| C=8 | H=10 | O=4

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Penicillic acid is a mycotoxin that is produced by Aspergillus flavus and Penicillium roqueforti mold. It is not a product of acid degradation of penicillin. Its first practical synthesis was reported in 1947 by Ralph Raphael, who had worked on penicillin during World War II.{{Cite journal | last1 =Raphael|first1=Ralph | title =Synthesis of the Antibiotic, Penicillic Acid | journal =Nature |volume=160 | year =1947 |issue=4060 | pages = 261–262 |doi=10.1038/160261c0|pmid=20344393 |bibcode=1947Natur.160..261R |s2cid=4066740 }}