pentabamate

{{short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 3-methylpentane-2,4-diyl dicarbamate

| image = Pentabamate.svg

| image_class = skin-invert-image

| CAS_number = 5667-70-9

| ATC_prefix = None

| ATC_suffix =

| UNII = 8871ZB4UGC

| PubChem = 3047822

| ChemSpiderID = 2310134

| C = 8 | H = 16 | N = 2 | O = 4

| smiles = O=C(OC(C(C(OC(=O)N)C)C)C)N

| StdInChI = 1S/C8H16N2O4/c1-4(5(2)13-7(9)11)6(3)14-8(10)12/h4-6H,1-3H3,(H2,9,11)(H2,10,12)

| StdInChIKey = XAIVVICFVUFHEP-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration =

}}

Pentabamate (S-109) is a tranquilizer of the carbamate family.{{cite journal |title=Carbamic acid esters of glycols |journal=Bulletin of the World Health Organization |volume=43 Suppl |pages=40–44 |year=1970 |issue=Suppl |pmid=20604369 |pmc=2427611}}{{cite web |url=http://whqlibdoc.who.int/hq/2004/WHO_EDM_QSM_2004.5.pdf |author=World Health Organization |title=The use of stems in the selection of International Nonproprietary Names (INN) for pharmaceutical substance |date=2004}}{{cite book | vauthors = Milne GW |title=Drugs: Synonyms and Properties |date=2018 |publisher=Routledge Revivals |location=London |isbn=978-1-351-78990-5 |page=7698 | chapter = Pentabamate | chapter-url=https://books.google.com/books?id=dloPEAAAQBAJ&q=Pentabamate&pg=PA487}}