pentafluranol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = 2-Fluoro-4-[5,5,5-trifluoro-3-(3-fluoro-4-hydroxyphenyl)pentan-2-yl]phenol

| image = Pentafluranol.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 65634-39-1

| CAS_supplemental =

| ATC_prefix = None

| ATC_suffix =

| ATC_supplemental =

| PubChem = 3047826

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 16737041

| UNII = 95RFZ48151

| KEGG =

| ChEBI =

| ChEMBL = 2105409

| C=17 | H=15 | F=5 | O=2

| smiles = CC(C1=CC(=C(C=C1)O)F)C(CC(F)(F)F)C2=CC(=C(C=C2)O)F

| StdInChI_Ref =

| StdInChI = 1S/C17H15F5O2/c1-9(10-2-4-15(23)13(18)6-10)12(8-17(20,21)22)11-3-5-16(24)14(19)7-11/h2-7,9,12,23-24H,8H2,1H3

| StdInChIKey_Ref =

| StdInChIKey = PRRSFMGODMUPJN-UHFFFAOYSA-N

| synonyms =

}}

Pentafluranol (INN, BAN; developmental code BX-430) is a synthetic, nonsteroidal estrogen of the stilbestrol group related to diethylstilbestrol that was developed for the treatment of benign prostatic hyperplasia never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PP1|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=1161}}{{cite book|author=Polska Akademia Nauk. Komitet Badania Polonii|title=II Kongres Uczonych Polskiego Pochodzenia: zbiór materiałów|url=https://books.google.com/books?id=_-VjAAAAIAAJ|year=1984|publisher=Zakład Narodowy im. Ossolińskich|isbn=978-83-04-01670-5|page=451}} It was described in the medical literature in 1974.