pentagestrone

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = 1-[(8R,9S,10R,13S,14S,17R)-3-cyclopentyloxy-17-hydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone

| image = Pentagestrone.svg

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Progestogen ether

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 7001-56-1

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| PubChem = 3047827

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 2310139

| UNII = L34YL185WL

| ChEMBL = 2104801

| synonyms = 17α-Hydroxyprogesterone 3-cyclopentyl enol ether

| C=26 | H=38 | O=3

| SMILES = CC(=O)C1(CCC2C1(CCC3C2CC=C4C3(CCC(=C4)OC5CCCC5)C)C)O

| StdInChI_Ref =

| StdInChI = 1S/C26H38O3/c1-17(27)26(28)15-12-23-21-9-8-18-16-20(29-19-6-4-5-7-19)10-13-24(18,2)22(21)11-14-25(23,26)3/h8,16,19,21-23,28H,4-7,9-15H2,1-3H3/t21-,22+,23+,24+,25+,26+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = RBFQPFFCDLXWQK-UXUCURBISA-N

}}

Pentagestrone ({{abbrlink|INN|International Nonproprietary Name}}), also known as 17α-hydroxyprogesterone 3-cyclopentyl enol ether, is a steroidal progestin of the 17α-hydroxyprogesterone group that was never marketed.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA943|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=943–}}{{cite book| vauthors = Wermuth CG |title=The Practice of Medicinal Chemistry|url=https://books.google.com/books?id=Qmt1_DQkCpEC&pg=PA731|date=2 May 2011|publisher=Academic Press|isbn=978-0-08-056877-5|pages=731–|author-link=Camille Georges Wermuth}} An acetate ester, pentagestrone acetate (Gestovis, Gestovister), has been marketed for clinical use. Pentagestrone was described in the literature in 1960.