pentamine
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = Ethyl-[2-[2-(ethyl-dimethyl-ammonio)ethyl-methyl-amino]ethyl]-dimethyl-ammonium
| image = Pentamine.svg
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 60-30-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 43XK6AW58D
| ATC_prefix =
| ATC_suffix =
| PubChem = 9383
| ChemSpiderID = 9014
| C=13 | H=33 | N=3
| smiles = CC[N+](C)(C)CCN(C)CC[N+](C)(C)CC
| StdInChI=1S/C13H33N3/c1-8-15(4,5)12-10-14(3)11-13-16(6,7)9-2/h8-13H2,1-7H3/q+2
| StdInChIKey = NHWGPUVJQFTOQX-UHFFFAOYSA-N
}}
Pentamine is a pharmaceutical drug that acts as a ganglionic blocker.{{cite journal | title = The effect of ganglioblocking agents on synaptic transmission of nervous excitation in the sympathetic ganglia | year = 1963 | vauthors = Kharkevich DA | journal = Bulletin of Experimental Biology and Medicine | volume = 54 | pages = 749–752 | s2cid = 848381 | doi = 10.1007/BF00785866 }}
References
{{Reflist}}
{{Nicotinic acetylcholine receptor modulators}}
Category:Nicotinic antagonists
Category:Quaternary ammonium compounds
{{nervous-system-drug-stub}}