pentylone

{{Short description|Stimulant drug of the substituted cathinone class}}

{{Redirect|NRG-3|the protein growth factor|Neuregulin 3}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451552327

| IUPAC_name = (±)-1-(1,3-benzodioxol-5-yl)-2-(methylamino)pentan-1-one

| image = Pentylone.svg

| tradename =

| pregnancy_category =

| legal_AU =

| legal_BR = F2

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-07-25}}

| legal_DE = Anlage I

| legal_UK = Class B

| legal_US = Schedule I

| legal_status = Illegal in Sweden and Finland

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 698963-77-8

| CAS_supplemental =
17763-01-8 (hydrochloride)

| UNII_Ref = {{fdacite|correct|FDA}}

| synonyms = β-Keto-Methylbenzodioxolylpentanamine, βk-Methyl-K, βk-MBDP, methylenedioxypentedrone, 1‐(3,4‐methylenedioxyphenyl)‐2‐(methylamino)pentan‐1‐one

| UNII = IGN39WGH0Q

| ATC_prefix = none

| ATC_suffix =

| PubChem = 60208608

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 29786041

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C13H17NO3/c1-3-4-10(14-2)13(15)9-5-6-11-12(7-9)17-8-16-11/h5-7,10,14H,3-4,8H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = DFMLULIEUUXXSA-UHFFFAOYSA-N

| C = 13

| H = 17

| N = 1

| O = 3

| smiles = c2cc1OCOc1cc2C(=O)C(NC)CCC

}}

Pentylone is a stimulant developed in the 1960s.{{cite patent | title = Substituted phenyl-α-amino ketones. | country = GB | number = 1085135 | gdate = 1969 }} It is a substituted cathinone that has been identified in some samples of powders sold as "NRG-1", along with varying blends of other cathinone derivatives including flephedrone, MDPBP, MDPV, and 4-MePPP.

It was also found in combination with 4-MePPP being sold as "NRG-3".{{cite journal | vauthors = Brandt SD, Freeman S, Sumnall HR, Measham F, Cole J | title = Analysis of NRG 'legal highs' in the UK: identification and formation of novel cathinones | journal = Drug Testing and Analysis | volume = 3 | issue = 9 | pages = 569–575 | date = September 2011 | pmid = 21960541 | doi = 10.1002/dta.204 }} Reports indicate side effects include paranoia, agitation, and insomnia, with effects lasting for several days at high doses.{{cite journal | vauthors = Bish J |title= Watch Out for Pentylone, the Horrible New MDMA Additive |journal=Vice |date=4 August 2017 |url= https://www.vice.com/en/article/watch-out-for-pentylone-the-horrible-new-mdma-additive/}}