perflubron

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid =

| IUPAC_name = 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane

| image = Perflubron structure.svg

| alt =

| caption =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 423-55-2

| ATCvet =

| ATC_prefix = V08

| ATC_suffix = CX01

| PubChem = 9873

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Q1D0Q7R4D9

| DrugBank =

| ChEMBL = 1200866

| ChemSpiderID = 9489

| smiles = FC(F)(C(F)(F)C(Br)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F

| StdInChI = 1S/C8BrF17/c9-7(22,23)5(18,19)3(14,15)1(10,11)2(12,13)4(16,17)6(20,21)8(24,25)26

| StdInChIKey = WTWWXOGTJWMJHI-UHFFFAOYSA-N

| C=8 | F=17 | Br=1

| density = 1.93

| boiling_point=142

| melting_point=6

}}

Perflubron (INN/USAN, or perfluorooctyl bromide; brand name Imagent) is a contrast medium for magnetic resonance imaging, computer tomography and sonography.{{cite journal | vauthors = Mattrey RF | title = Perfluorooctylbromide: a new contrast agent for CT, sonography, and MR imaging | journal = AJR. American Journal of Roentgenology | volume = 152 | issue = 2 | pages = 247–52 | date = February 1989 | pmid = 2643258 | doi = 10.2214/ajr.152.2.247 | doi-access = }} It was approved for this use in the United States by the Food and Drug Administration in 1993.[https://web.archive.org/web/20071213104224/http://www.accessdata.fda.gov/scripts/cder/drugsatfda/index.cfm?fuseaction=Search.DrugDetails FDA Approved Drug Products]

Experimental research

{{for|more information on this potential application|Liquid breathing#Medical treatment}}

Perflubron has also been tested experimentally for use in liquid breathing in premature infants with respiratory distress.{{cite journal | vauthors = Wolfson MR, Kechner NE, Roache RF, DeChadarevian JP, Friss HE, Rubenstein SD, Shaffer TH | title = Perfluorochemical rescue after surfactant treatment: effect of perflubron dose and ventilatory frequency | journal = Journal of Applied Physiology | volume = 84 | issue = 2 | pages = 624–40 | date = February 1998 | pmid = 9475875 | doi = 10.1152/jappl.1998.84.2.624 }}{{cite journal | vauthors = Leach CL, Greenspan JS, Rubenstein SD, Shaffer TH, Wolfson MR, Jackson JC, DeLemos R, Fuhrman BP | display-authors = 6 | title = Partial liquid ventilation with perflubron in premature infants with severe respiratory distress syndrome. The LiquiVent Study Group | journal = The New England Journal of Medicine | volume = 335 | issue = 11 | pages = 761–7 | date = September 1996 | pmid = 8778584 | doi = 10.1056/NEJM199609123351101 | doi-access = free }}

File:Molecular ball-and-stick model of Perflubron, overlayed with electron-density coded VdW model.png

References

{{reflist|33em}}

{{Contrast media}}

Category:MRI contrast agents

Category:Orphan drugs

Category:Chlorofluoroalkanes

{{pharma-stub}}