perfluoroheptane

{{Chembox

| Name = n-Perfluoroheptane

| ImageFile = Perfluoroheptane.svg

| ImageSize = 200px

| ImageName =

| ImageFile1 = Perfluoroheptane 3D ball.png

| ImageSize1 =

| ImageName1 = Ball-and-stick model of perfluoroheptane

| ImageFile2 = FluorocarbonCrabFish.JPG

| ImageCaption2 = Coloured water (top) and perfluoroheptane (bottom). Perfluoroheptane is hydrophobic and is denser than water, so it sinks to the bottom and the animals pictured cannot penetrate it.

| PIN = Hexadecafluoroheptane

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 335-57-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = I23ZVD1P1L

| PubChem = 9553

| ChemSpiderID = 9179

| SMILES = C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F

| InChI=1S/C7F16/c8-1(9,2(10,11)4(14,15)6(18,19)20)3(12,13)5(16,17)7(21,22)23

| InChIKey=LGUZHRODIJCVOC-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=7 | F=16

| Appearance = clear liquid{{cite web|title=Perfluoro-n-heptane Safety Data Sheet|url=http://www.exfluor.com/PDF/C7.pdf|publisher=Exfluor Research Corporation |access-date=2020-04-30}}

| Density = 1.706 g/cm3

| MeltingPt =

| BoilingPt = 80~82°C

| Solubility =}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =}}

}}

Perfluoroheptane, C7F16, (usually referring to the straight chain molecule called n-perfluoroheptane) is a perfluorocarbon.[https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?q=all&cid=9553 Pubchem (USG) page on perfluoroheptane] It is hydrophobic (water-insoluble) and oleophobic (oil-insoluble). It is used in deacidification of paper as a medium carrying powdered magnesium oxide.{{cite book|author=Porck, Henk J. |title=Mass Deacidification: An Update on Possibilities and Limitations |url=http://files.eric.ed.gov/fulltext/ED401893.pdf |year=1996 |publisher=Commission on Preservation and Access |location=Washington D.C. |isbn=1887334521 |pages=16 |access-date=2015-12-09}}

References

{{reflist}}

Category:Perfluoroalkanes

{{Organohalide-stub}}