peroxynitrate

{{Chembox

|ImageFile=Peroxynitrate.svg

|Section1={{Chembox Identifiers

| CASNo = 125239-87-4

| CASNo_Ref = {{Cascite|changed|EPA}}

| ChEBI = 29270

| ChemSpiderID = 4574117

| PubChem = 5460620

| SMILES = [N+](=O)([O-])O[O-]

| StdInChI=1S/HNO4/c2-1(3)5-4/h4H/p-1

| StdInChIKey = UUZZMWZGAZGXSF-UHFFFAOYSA-M

}}

|Section2={{Chembox Properties

| N=1|O=4

| Formula_Charge = −

}}

|Section8={{Chembox Related

| OtherCompounds = peroxycarbonate; peroxysulfate

}}

}}

Peroxynitrate (or peroxonitrate) refers to salts of the unstable peroxynitric acid, HNO₄. Peroxynitrate is unstable and decomposes to nitrate and dioxygen.{{Cite journal|last1=Miyamoto|first1=Sayuri|last2=Ronsein|first2=Graziella E.|last3=Corrêa|first3=Thaís C.|last4=Martinez|first4=Glaucia R.|last5=Medeiros|first5=Marisa H. G.|last6=Di Mascio|first6=Paolo|date=2009|title=Direct evidence of singlet molecular oxygen generation from peroxynitrate, a decomposition product of peroxynitrite|url=http://dx.doi.org/10.1039/b905560f|journal=Dalton Transactions|issue=29|pages=5720–5729|doi=10.1039/b905560f|pmid=20449086 |issn=1477-9226|url-access=subscription}}

No solid peroxynitrate salts are known.{{Greenwood&Earnshaw}} However, there is a report that the chemist Sebastian Moiseevich Tanatar produced sodium peroxynitrate octahydrate (NaNO₃·H₂O₂·8H₂O) by evaporating a solution of sodium nitrate and hydrogen peroxide until crystallisation begins and then mixing with alcohol to form crystals of the octahydrate.{{cite book|last=Mellor|first=Joseph William|authorlink=Joseph Mellor|title=A Comprehensive Treatise on Inorganic and Theoretical Chemistry, Volume 2|year=1922|publisher=Longmans, Green and Co.|location=New York|pages=816|url=https://archive.org/details/b2980789x_0002/page/816/mode/2up}}