petrichloral

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 448002549

| IUPAC_name = 2,2,2-trichloro-1-[3-(2,2,2-trichloro-1-hydroxyethoxy)-2,2-bis[(2,2,2-trichloro-1-hydroxyethoxy)methyl]propoxy]ethanol

| image = Petrichloral.svg

| width = 200

| tradename = Periclor

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 78-12-6

| ATC_prefix = none

| ATC_suffix =

| PubChem = 6519

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = U49LID4UYJ

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 6272

| smiles = ClC(Cl)(Cl)C(O)OCC(COC(O)C(Cl)(Cl)Cl)(COC(O)C(Cl)(Cl)Cl)COC(O)C(Cl)(Cl)Cl

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C13H16Cl12O8/c14-10(15,16)5(26)30-1-9(2-31-6(27)11(17,18)19,3-32-7(28)12(20,21)22)4-33-8(29)13(23,24)25/h5-8,26-29H,1-4H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = OKACKALPXHBEMA-UHFFFAOYSA-N

| C=13 | H=16 | Cl=12 | O=8

| synonyms =

}}

Petrichloral (pentaerythritol chloral, brand name Periclor) is a sedative and hypnotic chloral hydrate prodrug.{{cite patent | country = US | number = 2784237 | title = Chloral derivatives and methods for their preparation | inventor = Bruce WF | assign1 = American Home Products | gdate = 5 March 1957 }}{{cite book | vauthors = Krantz JC, Charles Jelleff Carr CJ, Aviado DM |title=Krantz and Carr's Pharmacologic principles of medical practice: a textbook on pharmacology and therapeutics for students and practitioners of medicine, pharmacy, and dentistry |date=1972 |publisher=Williams & Wilkins |location=Baltimore, MD |isbn=978-0-683-00292-8 |page=79 |edition=8th | chapter = Petrichloral | chapter-url= https://books.google.com/books?id=C-tsAAAAMAAJ&q=Petrichloral}} It is a Schedule IV drug in the USA.{{cite journal | title = Depressant and stimulant drugs; listing of additional drugs as drugs subject to control | journal = Federal Register | volume = 31 | pages = 12435–6 | date = 1966 }}