phanquinone

{{Short description|Chemical compound}}

{{Distinguish|Phenanthrenequinone}}

{{Chembox

| ImageFile = Phanquinone.svg

| ImageSize =

| ImageAlt =

| IUPACName =

| OtherNames = 4,7-phenanthroline-5,6-dione

|Section1={{Chembox Identifiers

| CASNo = 84-12-8

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChEBI = 59141

| ChEMBL = 531048

| ChemSpiderID = 6506

| DrugBank = DB13469

| EC_number = 201-516-0

| Gmelin = 365810

| KEGG = D07359

| PubChem = 6764

| UNII = ID94IS6N8J

| StdInChI=1S/C12H6N2O2/c15-11-9-7(3-1-5-13-9)8-4-2-6-14-10(8)12(11)16/h1-6H

| StdInChIKey = VLPADTBFADIFKG-UHFFFAOYSA-N

| SMILES = O=C3c1ncccc1c2c(nccc2)C3=O}}

|Section2={{Chembox Properties

| C=12 | H=6 | N=2 | O=2

| MolarMass =

| Appearance = yellow solid

| Density =

| MeltingPtC = 295

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility = }}

|Section3={{Chembox Hazards

| GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/6764#section=Safety-and-Hazards]

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|302|312|332|412}}

| PPhrases = {{P-phrases|261|264|270|271|273|280|301+317|302+352|304+340|317|321|330|362+364|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Phanquinone is an organic compound with the formula {{chem2|C12H6N2O2}}. It is derived by oxidation of 4,7-phenanthroline.

It has been investigated as both antiprotozoal agent and for its bactericidal activity .{{cite journal |vauthors=Mett H, Gyr K, Zak O, Vosbeck K |title=Duodeno-pancreatic secretions enhance bactericidal activity of antimicrobial drugs |journal=Antimicrob. Agents Chemother. |volume=26 |issue=1 |pages=35–8 |date=July 1984 |pmid=6236746 |pmc=179912 |doi= 10.1128/aac.26.1.35|url=}} It has an extensive role as a ligand in coordination chemistry.{{cite journal |doi=10.1021/ja00351a049 |title=Chemical properties of phenanthrolinequinones and the mechanism of amine oxidation by o-quinones of medium redox potentials |date=1983 |last1=Eckert |first1=Timothy S. |last2=Bruice |first2=Thomas C. |journal=Journal of the American Chemical Society |volume=105 |issue=13 |pages=4431–4441 |bibcode=1983JAChS.105.4431E }}{{cite journal |doi=10.1002/chem.200305275 |title=On the Nature of the Plateau in Two-Step Dinuclear Spin-Crossover Complexes |date=2004 |last1=Ksenofontov |first1=Vadim |last2=Gaspar |first2=Ana B. |last3=Niel |first3=Virginie |last4=Reiman |first4=Sergey |last5=Real |first5=José A. |last6=Gütlich |first6=Philipp |journal=Chemistry – A European Journal |volume=10 |issue=5 |pages=1291–1298 |pmid=15007819 }}